Difference between revisions of "Ec-22 000050"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] == * smiles: ** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23)...")
 
(Created page with "Category:Gene == Gene Ec-22_000050 == * left end position: ** 57374 * transcription direction: ** NEGATIVE * right end position: ** 60586 * centisome position: ** 1.270502...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] ==
+
== Gene Ec-22_000050 ==
−
* smiles:
+
* left end position:
−
** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))
+
** 57374
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** ent-7α-hydroxykaur-16-en-19-oate
+
** 60586
−
* molecular weight:
+
* centisome position:
−
** 317.447    
+
** 1.2705026    
 
* Synonym(s):
 
* Synonym(s):
−
** ent-7-α-hydroxykaurenoate
+
** Esi_0437_0011
−
** ent-7-α-hydroxykaurenoic acid
+
** Esi0437_0011
−
** 7-hydroxy-kaurenoic acid
+
** PHL1
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN1F-160]]
+
* Reaction: [[2.7.13.3-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[1.14.13.79-RXN]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104540005
+
{{#set: left end position=57374}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200352 25200352]
+
{{#set: right end position=60586}}
−
* CHEBI:
+
{{#set: centisome position=1.2705026   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57298 57298]
+
{{#set: common name=Esi_0437_0011|Esi0437_0011|PHL1}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=2.7.13.3-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11875 C11875]
+
−
{{#set: smiles=C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))}}
+
−
{{#set: inchi key=InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M}}
+
−
{{#set: common name=ent-7α-hydroxykaur-16-en-19-oate}}
+
−
{{#set: molecular weight=317.447   }}
+
−
{{#set: common name=ent-7-α-hydroxykaurenoate|ent-7-α-hydroxykaurenoic acid|7-hydroxy-kaurenoic acid}}
+
−
{{#set: consumed by=RXN1F-160}}
+
−
{{#set: produced by=1.14.13.79-RXN}}
+

Latest revision as of 19:04, 21 March 2018

Gene Ec-22_000050

  • left end position:
    • 57374
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 60586
  • centisome position:
    • 1.2705026
  • Synonym(s):
    • Esi_0437_0011
    • Esi0437_0011
    • PHL1

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-22_000050&oldid=24274"