Difference between revisions of "DEOXYHYPUSINE-MONOOXYGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DEOXYHYPUSINE-MONOOXYGENASE-RXN DEOXYHYPUSINE-MONOOXYGENASE-RXN] == * direction: ** LEFT-TO-RIGHT *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DEOXYHYPUSINE-MONOOXYGENASE-RXN DEOXYHYPUSINE-MONOOXYGENASE-RXN] ==
−
* smiles:
+
* direction:
−
** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
+
** [http://enzyme.expasy.org/EC/1.14.99.29 EC-1.14.99.29]
−
* common name:
+
−
** salicyl-6-hydroxy-2-cyclohexene-on-oyl
+
−
* molecular weight:
+
−
** 262.262   
+
 
* Synonym(s):
 
* Synonym(s):
−
** salicyl-HCH
 
−
** 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
 
−
** acylsaligenin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12252]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-9973]][c] '''+''' 1 [[Donor-H2]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[Acceptor]][c] '''+''' 1 [[EIF5A-HYPUSINE]][c] '''+''' 1 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 an [eIF5A-precursor]-deoxyhypusine[c] '''+''' 1 an reduced unknown electron acceptor[c] '''+''' 1 oxygen[c] '''=>''' 1 an oxidized unknown electron acceptor[c] '''+''' 1 an [eIF5A]-hypusine[c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-5905]], hypusine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5905 PWY-5905]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 529507-98-0
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R04437 R04437]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14731723 14731723]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: smiles=C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O}}
+
{{#set: ec number=EC-1.14.99.29}}
−
{{#set: inchi key=InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N}}
+
{{#set: in pathway=PWY-5905}}
−
{{#set: common name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=262.262    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=salicyl-HCH|2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester|acylsaligenin}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: consumed by=RXN-12252}}
+

Latest revision as of 19:53, 21 March 2018

Reaction DEOXYHYPUSINE-MONOOXYGENASE-RXN

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 an [eIF5A-precursor]-deoxyhypusine[c] + 1 an reduced unknown electron acceptor[c] + 1 oxygen[c] => 1 an oxidized unknown electron acceptor[c] + 1 an [eIF5A]-hypusine[c] + 1 H2O[c]

Genes associated with this reaction

Pathways

  • PWY-5905, hypusine biosynthesis: PWY-5905
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=DEOXYHYPUSINE-MONOOXYGENASE-RXN&oldid=30075"