Difference between revisions of "RXN-14789"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-182 CPD-182] == * smiles: ** CC1(=CC(OC2(C=C(O)C=CC1=2))=O) * inchi key: ** InChIKey=HSHNIT...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14789 RXN-14789] == * direction: ** LEFT-TO-RIGHT * common name: ** Acyl-CoA oxidase/dehydrogen...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-182 CPD-182] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14789 RXN-14789] ==
−
* smiles:
+
* direction:
−
** CC1(=CC(OC2(C=C(O)C=CC1=2))=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HSHNITRMYYLLCV-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 4-methylumbelliferone
+
** Acyl-CoA oxidase/dehydrogenase, central domain
−
* molecular weight:
+
** acyl-CoA oxidase, partial
−
** 176.171   
+
** acyl-CoA oxidase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6]
 
* Synonym(s):
 
* Synonym(s):
−
** Hymecromone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-10769]]
+
** 1 [[CPD-15677]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[CPD-15661]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 4-trans-undecenoyl-CoA[c] '''+''' 1 oxygen[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 2-trans, 4-trans-undecadienoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-22_002920]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-26_004320]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-08_006390]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7338]], 10-trans-heptadecenoyl-CoA degradation (reductase-dependent, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7338 PWY-7338]
 +
** '''3''' reactions found over '''12''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 90-33-5
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* DRUGBANK : DB07118
+
{{#set: common name=Acyl-CoA oxidase/dehydrogenase, central domain}}
−
* PUBCHEM:
+
{{#set: common name=acyl-CoA oxidase, partial}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280567 5280567]
+
{{#set: common name=acyl-CoA oxidase}}
−
* HMDB : HMDB59622
+
{{#set: ec number=EC-1.3.3.6}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-22_002920|Ec-26_004320|Ec-08_006390}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03081 C03081]
+
{{#set: in pathway=PWY-7338}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.4444190.html 4444190]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17224 17224]
+
−
* METABOLIGHTS : MTBLC17224
+
−
{{#set: smiles=CC1(=CC(OC2(C=C(O)C=CC1=2))=O)}}
+
−
{{#set: inchi key=InChIKey=HSHNITRMYYLLCV-UHFFFAOYSA-N}}
+
−
{{#set: common name=4-methylumbelliferone}}
+
−
{{#set: molecular weight=176.171    }}
+
−
{{#set: common name=Hymecromone}}
+
−
{{#set: produced by=RXN-10769}}
+

Latest revision as of 19:53, 21 March 2018

Reaction RXN-14789

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Acyl-CoA oxidase/dehydrogenase, central domain
    • acyl-CoA oxidase, partial
    • acyl-CoA oxidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7338, 10-trans-heptadecenoyl-CoA degradation (reductase-dependent, yeast): PWY-7338
    • 3 reactions found over 12 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-14789&oldid=30093"