Difference between revisions of "Ec-09 002640"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYINDOLE DIHYDROXYINDOLE] == * smiles: ** C1(=CNC2(=C1C=C(O)C(O)=C2)) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Ec-09_002640 == * left end position: ** 2996775 * transcription direction: ** NEGATIVE * right end position: ** 3005140 * centisome position: ** 53.3...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-09_002640 == |
− | * | + | * left end position: |
− | ** | + | ** 2996775 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3005140 |
− | * | + | * centisome position: |
− | ** | + | ** 53.38837 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0171_0026 |
− | ** | + | ** Esi0171_0026 |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2.7.10.1-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | * Reaction: [[PROTEIN-KINASE-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2996775}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3005140}} | |
− | + | {{#set: centisome position=53.38837 }} | |
− | + | {{#set: common name=Esi_0171_0026|Esi0171_0026}} | |
− | + | {{#set: reaction associated=2.7.10.1-RXN|PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:53, 21 March 2018
Gene Ec-09_002640
- left end position:
- 2996775
- transcription direction:
- NEGATIVE
- right end position:
- 3005140
- centisome position:
- 53.38837
- Synonym(s):
- Esi_0171_0026
- Esi0171_0026
Reactions associated
- Reaction: 2.7.10.1-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome