Difference between revisions of "CPD-17328"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Double-Stranded-DNAs Double-Stranded-DNAs] == * common name: ** a double stranded DNA * Synonym...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17328 CPD-17328] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17328 CPD-17328] == |
+ | * smiles: | ||
+ | ** CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=OKOXEYTYHDPTEW-GJYKHRJNSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** (9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA |
+ | * molecular weight: | ||
+ | ** 1106.066 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-17112]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-17111]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581220 71581220] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74087 74087] | ||
+ | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=OKOXEYTYHDPTEW-GJYKHRJNSA-J}} | ||
+ | {{#set: common name=(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA}} | ||
+ | {{#set: molecular weight=1106.066 }} | ||
+ | {{#set: common name=(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-17112}} | ||
+ | {{#set: produced by=RXN-17111}} |
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite CPD-17328
- smiles:
- CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=OKOXEYTYHDPTEW-GJYKHRJNSA-J
- common name:
- (9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA
- molecular weight:
- 1106.066
- Synonym(s):
- (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.