Difference between revisions of "3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-]...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN 3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN] == * direction: ** L...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN 3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN] ==
−
* smiles:
+
* direction:
−
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K
+
 
* common name:
 
* common name:
−
** ADP ribose 1'',2''-cyclic phosphate
+
** NADP-dependent 3-hydroxyisobutyrate dehydrogenase, NAD-binding domain
−
* molecular weight:
+
* ec number:
−
** 618.26   
+
** [http://enzyme.expasy.org/EC/1.1.1.31 EC-1.1.1.31]
 
* Synonym(s):
 
* Synonym(s):
−
** ADP ribose 1''-2''-cyclic phosphate
 
−
** ADP ribose 1'',2''-phosphate
 
−
** adenosine diphosphate ribose 1'',2''-cyclic phosphate
 
−
** Appr>p
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12055]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD]][c] '''+''' 1 [[CPD-12175]][c] '''=>''' 1 [[CH3-MALONATE-S-ALD]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c]
−
* [[2.7.1.160-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 NAD+[c] '''+''' 1 (S)-3-hydroxy-isobutanoate[c] '''=>''' 1 (S)-methylmalonate-semialdehyde[c] '''+''' 1 H+[c] '''+''' 1 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-14_006530]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-11_000140]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[VALDEG-PWY]], L-valine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=VALDEG-PWY VALDEG-PWY]
 +
** '''8''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245989 25245989]
+
** [http://www.genome.jp/dbget-bin/www_bget?R02047 R02047]
−
* CHEBI:
+
* UNIPROT:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76596 76596]
+
** [http://www.uniprot.org/uniprot/P29266 P29266]
−
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O}}
+
** [http://www.uniprot.org/uniprot/P28811 P28811]
−
{{#set: inchi key=InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K}}
+
** [http://www.uniprot.org/uniprot/Q8XAE4 Q8XAE4]
−
{{#set: common name=ADP ribose 1'',2''-cyclic phosphate}}
+
** [http://www.uniprot.org/uniprot/Q55702 Q55702]
−
{{#set: molecular weight=618.26    }}
+
** [http://www.uniprot.org/uniprot/Q9XTI0 Q9XTI0]
−
{{#set: common name=ADP ribose 1''-2''-cyclic phosphate|ADP ribose 1'',2''-phosphate|adenosine diphosphate ribose 1'',2''-cyclic phosphate|Appr>p}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: consumed by=RXN-12055}}
+
{{#set: common name=NADP-dependent 3-hydroxyisobutyrate dehydrogenase, NAD-binding domain}}
−
{{#set: produced by=2.7.1.160-RXN}}
+
{{#set: ec number=EC-1.1.1.31}}
 +
{{#set: gene associated=Ec-14_006530|Ec-11_000140}}
 +
{{#set: in pathway=VALDEG-PWY}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 19:54, 21 March 2018

Reaction 3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • NADP-dependent 3-hydroxyisobutyrate dehydrogenase, NAD-binding domain
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 (S)-3-hydroxy-isobutanoate[c] => 1 (S)-methylmalonate-semialdehyde[c] + 1 H+[c] + 1 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • VALDEG-PWY, L-valine degradation I: VALDEG-PWY
    • 8 reactions found over 8 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN&oldid=30163"