Difference between revisions of "Ec-24 000650"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O...")
 
(Created page with "Category:Gene == Gene Ec-24_000650 == * left end position: ** 744997 * transcription direction: ** NEGATIVE * right end position: ** 748784 * centisome position: ** 14.936...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] ==
+
== Gene Ec-24_000650 ==
−
* smiles:
+
* left end position:
−
** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
+
** 744997
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** betanidin
+
** 748784
−
* molecular weight:
+
* centisome position:
−
** 386.317    
+
** 14.936768    
 
* Synonym(s):
 
* Synonym(s):
−
** betanidin radical
+
** Esi_0019_0033
−
** 2,6-Pyridinedicarboxylic acid
+
** Esi0019_0033
 +
** UROD3
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-8635]]
+
* Reaction: [[RXN-10642]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[UROGENDECARBOX-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[HEMESYN2-PWY]]
 +
* [[PWY0-1415]]
 +
* [[PWY-7159]]
 +
* [[PWY-7766]]
 +
* [[CHLOROPHYLL-SYN]]
 +
* [[HEME-BIOSYNTHESIS-II]]
 +
* [[PWY-5531]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB00217
+
{{#set: left end position=744997}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245506 25245506]
+
{{#set: right end position=748784}}
−
* CHEBI:
+
{{#set: centisome position=14.936768   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3079 3079]
+
{{#set: common name=Esi_0019_0033|Esi0019_0033|UROD3}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=RXN-10642|UROGENDECARBOX-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08539 C08539]
+
{{#set: pathway associated=HEMESYN2-PWY|PWY0-1415|PWY-7159|PWY-7766|CHLOROPHYLL-SYN|HEME-BIOSYNTHESIS-II|PWY-5531}}
−
* HMDB : HMDB29407
+
−
{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
+
−
{{#set: inchi key=InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L}}
+
−
{{#set: common name=betanidin}}
+
−
{{#set: molecular weight=386.317   }}
+
−
{{#set: common name=betanidin radical|2,6-Pyridinedicarboxylic acid}}
+
−
{{#set: consumed by=RXN-8635}}
+

Latest revision as of 19:54, 21 March 2018

Gene Ec-24_000650

  • left end position:
    • 744997
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 748784
  • centisome position:
    • 14.936768
  • Synonym(s):
    • Esi_0019_0033
    • Esi0019_0033
    • UROD3

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-24_000650&oldid=30166"