Difference between revisions of "RXN1F-147"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-] * inchi key: ** InChI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-147 RXN1F-147] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/5.5...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-147 RXN1F-147] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/5.5.1.18 EC-5.5.1.18] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD1F-114]][c] '''<=>''' 1 [[CPD1F-115]][c] |
− | == | + | * With common name(s): |
+ | ** 1 all-trans-lycopene[c] '''<=>''' 1 δ-carotene[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-00_005820]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-02_005510]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-00_005850]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-07_007260]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-24_002150]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-24_002140]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-10_006240]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5946]], δ-carotene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5946 PWY-5946] | ||
+ | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R06963 R06963] | |
− | ** [http:// | + | {{#set: direction=REVERSIBLE}} |
− | + | {{#set: ec number=EC-5.5.1.18}} | |
− | + | {{#set: gene associated=Ec-00_005820|Ec-02_005510|Ec-00_005850|Ec-07_007260|Ec-24_002150|Ec-24_002140|Ec-10_006240}} | |
− | + | {{#set: in pathway=PWY-5946}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | {{#set: | + | {{#set: reconstruction source=orthology-aragem}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:54, 21 March 2018
Contents
Reaction RXN1F-147
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 all-trans-lycopene[c] <=> 1 δ-carotene[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-00_005820
- Source: orthology-aragem
- Gene: Ec-02_005510
- Source: orthology-aragem
- Gene: Ec-00_005850
- Source: orthology-aragem
- Gene: Ec-07_007260
- Source: orthology-aragem
- Gene: Ec-24_002150
- Source: orthology-aragem
- Gene: Ec-24_002140
- Source: orthology-aragem
- Gene: Ec-10_006240
- Source: orthology-aragem
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
External links
- LIGAND-RXN: