Difference between revisions of "CPD-3481"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-05_005340 == * left end position: ** 7266099 * transcription direction: ** NEGATIVE * right end position: ** 7275933 * centisome position: ** 79.8...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] == * smiles: ** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InChI...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-05_005340 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] ==
−
* left end position:
+
* smiles:
−
** 7266099
+
** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O
−
* right end position:
+
* common name:
−
** 7275933
+
** bupropion
−
* centisome position:
+
* molecular weight:
−
** 79.816505    
+
** 240.752    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0152_0022
+
** (-)-2-(tert-butylamino)-3'-chloropropiophenone
−
** Esi0152_0022
+
** 1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-
 +
** (+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone
 +
** amfebutamonum
 +
** α-(tert-butylamino)-m-chloropropiophenone
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ATPASE-RXN]]
+
* [[RXN66-181]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
== Reaction(s) of unknown directionality ==
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
* [[RXN-12195]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
* [[RXN-12196]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
* [[RXN0-5462]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
== Pathways associated ==
+
−
* [[PWY-7184]]
+
−
* [[PWY-7198]]
+
−
* [[PWY-6545]]
+
−
* [[PWY-7210]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=7266099}}
+
* DRUGBANK : DB01156
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=7275933}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24849133 24849133]
−
{{#set: centisome position=79.816505   }}
+
* CHEBI:
−
{{#set: common name=Esi_0152_0022|Esi0152_0022}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3219 3219]
−
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06860 C06860]
 +
* HMDB : HMDB01510
 +
{{#set: smiles=CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)}}
 +
{{#set: inchi key=InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O}}
 +
{{#set: common name=bupropion}}
 +
{{#set: molecular weight=240.752   }}
 +
{{#set: common name=(-)-2-(tert-butylamino)-3'-chloropropiophenone|1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-|(+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone|amfebutamonum|α-(tert-butylamino)-m-chloropropiophenone}}
 +
{{#set: consumed by=RXN66-181}}

Latest revision as of 19:54, 21 March 2018

Metabolite CPD-3481

  • smiles:
    • CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)
  • inchi key:
    • InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O
  • common name:
    • bupropion
  • molecular weight:
    • 240.752
  • Synonym(s):
    • (-)-2-(tert-butylamino)-3'-chloropropiophenone
    • 1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-
    • (+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone
    • amfebutamonum
    • α-(tert-butylamino)-m-chloropropiophenone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-3481&oldid=30200"