Difference between revisions of "HYDROXY-METHYL-BUTENYL-DIP"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-19_001690 == * left end position: ** 1814985 * transcription direction: ** NEGATIVE * right end position: ** 1830643 * centisome position: ** 30.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-METHYL-BUTENYL-DIP HYDROXY-METHYL-BUTENYL-DIP] == * smiles: ** CC(CO)=CCOP(OP([O-])(=O)...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-METHYL-BUTENYL-DIP HYDROXY-METHYL-BUTENYL-DIP] == |
− | * | + | * smiles: |
− | ** | + | ** CC(CO)=CCOP(OP([O-])(=O)[O-])(=O)[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=MDSIZRKJVDMQOQ-GORDUTHDSA-K |
− | * | + | * common name: |
− | ** | + | ** (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 259.069 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (E)-4-hydroxy-3-methylbut 2-en-1-yl diphosphate |
− | ** | + | ** HMBDP |
+ | ** 1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[ISPH2-RXN]] |
− | + | * [[RXN0-884]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN0-882]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21597501 21597501] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10224038.html 10224038] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=128753 128753] |
− | {{#set: | + | * BIGG : 1446395 |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11811 C11811] | ||
+ | {{#set: smiles=CC(CO)=CCOP(OP([O-])(=O)[O-])(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=MDSIZRKJVDMQOQ-GORDUTHDSA-K}} | ||
+ | {{#set: common name=(E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate}} | ||
+ | {{#set: molecular weight=259.069 }} | ||
+ | {{#set: common name=(E)-4-hydroxy-3-methylbut 2-en-1-yl diphosphate|HMBDP|1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate}} | ||
+ | {{#set: consumed by=ISPH2-RXN|RXN0-884}} | ||
+ | {{#set: produced by=RXN0-882}} |
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite HYDROXY-METHYL-BUTENYL-DIP
- smiles:
- CC(CO)=CCOP(OP([O-])(=O)[O-])(=O)[O-]
- inchi key:
- InChIKey=MDSIZRKJVDMQOQ-GORDUTHDSA-K
- common name:
- (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
- molecular weight:
- 259.069
- Synonym(s):
- (E)-4-hydroxy-3-methylbut 2-en-1-yl diphosphate
- HMBDP
- 1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CO)=CCOP(OP([O-])(=O)[O-])(=O)[O-" cannot be used as a page name in this wiki.