Difference between revisions of "Ec-25 002110"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * smiles: ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-25_002110 == * left end position: ** 2405422 * transcription direction: ** NEGATIVE * right end position: ** 2413496 * centisome position: ** 54.0...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-25_002110 == |
− | * | + | * left end position: |
− | ** | + | ** 2405422 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2413496 |
− | * | + | * centisome position: |
− | ** | + | ** 54.043037 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0116_0004 |
− | ** | + | ** Esi0116_0004 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | * Reaction: [[GPPSYN-RXN]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7736]] | ||
+ | * [[PWY-7410]] | ||
+ | * [[PWY-6859]] | ||
+ | * [[PWY-7709]] | ||
+ | * [[PWY-6383]] | ||
+ | * [[PWY-7182]] | ||
+ | * [[PWY-6708]] | ||
+ | * [[PWY-7141]] | ||
+ | * [[PWY-5123]] | ||
+ | * [[PWY-5122]] | ||
+ | * [[PWY-7102]] | ||
+ | * [[PWY-7659]] | ||
+ | * [[PWY-5870]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2405422}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2413496}} | |
− | + | {{#set: centisome position=54.043037 }} | |
− | + | {{#set: common name=Esi_0116_0004|Esi0116_0004}} | |
− | + | {{#set: reaction associated=4OHBENZOATE-OCTAPRENYLTRANSFER-RXN|GPPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7736|PWY-7410|PWY-6859|PWY-7709|PWY-6383|PWY-7182|PWY-6708|PWY-7141|PWY-5123|PWY-5122|PWY-7102|PWY-7659|PWY-5870}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:55, 21 March 2018
Gene Ec-25_002110
- left end position:
- 2405422
- transcription direction:
- NEGATIVE
- right end position:
- 2413496
- centisome position:
- 54.043037
- Synonym(s):
- Esi_0116_0004
- Esi0116_0004
Reactions associated
- Reaction: 4OHBENZOATE-OCTAPRENYLTRANSFER-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: GPPSYN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
Pathways associated
- PWY-7736
- PWY-7410
- PWY-6859
- PWY-7709
- PWY-6383
- PWY-7182
- PWY-6708
- PWY-7141
- PWY-5123
- PWY-5122
- PWY-7102
- PWY-7659
- PWY-5870