Difference between revisions of "Ec-23 001940"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * smiles: ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C * inchi key: ** InChIKey=HII...")
 
(Created page with "Category:Gene == Gene Ec-23_001940 == * left end position: ** 2021105 * transcription direction: ** NEGATIVE * right end position: ** 2029685 * centisome position: ** 41.7...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] ==
+
== Gene Ec-23_001940 ==
−
* smiles:
+
* left end position:
−
** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C
+
** 2021105
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (2S)-2-isopropyl-3-oxosuccinate
+
** 2029685
−
* molecular weight:
+
* centisome position:
−
** 172.137    
+
** 41.762966    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-isopropyl-3-oxosuccinate
+
** Esi_0042_0065
 +
** Esi0042_0065
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7800]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
−
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=2021105}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04236 C04236]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=2029685}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17214 17214]
+
{{#set: centisome position=41.762966   }}
−
* BIGG : 43420
+
{{#set: common name=Esi_0042_0065|Esi0042_0065}}
−
* PUBCHEM:
+
{{#set: reaction associated=ATPASE-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419705 6419705]
+
−
* HMDB : HMDB12149
+
−
{{#set: smiles=CC(C(C(=O)[O-])C(=O)C(=O)[O-])C}}
+
−
{{#set: inchi key=InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L}}
+
−
{{#set: common name=(2S)-2-isopropyl-3-oxosuccinate}}
+
−
{{#set: molecular weight=172.137   }}
+
−
{{#set: common name=2-isopropyl-3-oxosuccinate}}
+
−
{{#set: consumed by=RXN-7800}}
+
−
{{#set: consumed or produced by=3-ISOPROPYLMALDEHYDROG-RXN}}
+

Latest revision as of 19:55, 21 March 2018

Gene Ec-23_001940

  • left end position:
    • 2021105
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2029685
  • centisome position:
    • 41.762966
  • Synonym(s):
    • Esi_0042_0065
    • Esi0042_0065

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-23_001940&oldid=30311"