Difference between revisions of "Ec-23 001940"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * smiles: ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C * inchi key: ** InChIKey=HII...") |
(Created page with "Category:Gene == Gene Ec-23_001940 == * left end position: ** 2021105 * transcription direction: ** NEGATIVE * right end position: ** 2029685 * centisome position: ** 41.7...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-23_001940 == |
− | * | + | * left end position: |
− | ** | + | ** 2021105 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2029685 |
− | * | + | * centisome position: |
− | ** | + | ** 41.762966 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0042_0065 |
+ | ** Esi0042_0065 | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[ATPASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
− | + | == Pathways associated == | |
== External links == | == External links == | ||
− | + | {{#set: left end position=2021105}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2029685}} | |
− | + | {{#set: centisome position=41.762966 }} | |
− | + | {{#set: common name=Esi_0042_0065|Esi0042_0065}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:55, 21 March 2018
Gene Ec-23_001940
- left end position:
- 2021105
- transcription direction:
- NEGATIVE
- right end position:
- 2029685
- centisome position:
- 41.762966
- Synonym(s):
- Esi_0042_0065
- Esi0042_0065
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome