Difference between revisions of "CPD-17046"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_009400 == * left end position: ** 7981283 * transcription direction: ** NEGATIVE * right end position: ** 7991976 * centisome position: ** 77.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17046 CPD-17046] == * smiles: ** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)C...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17046 CPD-17046] == |
− | * | + | * smiles: |
− | ** | + | ** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=YJISLDWVIYDIOE-WGTGPSAHSA-L |
− | * | + | * common name: |
− | ** | + | ** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine |
− | * | + | * molecular weight: |
− | ** | + | ** 842.848 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-DKP |
− | ** | + | ** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)piperazine-2,5-dione |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-15681]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-15680]] |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657797 90657797] |
− | {{#set: | + | {{#set: smiles=C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=YJISLDWVIYDIOE-WGTGPSAHSA-L}} |
− | {{#set: common name= | + | {{#set: common name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine}} |
− | {{#set: | + | {{#set: molecular weight=842.848 }} |
+ | {{#set: common name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)piperazine-2,5-dione}} | ||
+ | {{#set: consumed by=RXN-15681}} | ||
+ | {{#set: produced by=RXN-15680}} |
Latest revision as of 19:55, 21 March 2018
Contents
Metabolite CPD-17046
- smiles:
- C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
- inchi key:
- InChIKey=YJISLDWVIYDIOE-WGTGPSAHSA-L
- common name:
- 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
- molecular weight:
- 842.848
- Synonym(s):
- 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-DKP
- 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)piperazine-2,5-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.