Difference between revisions of "Ec-06 002450"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYTOCHROMOBILIN 3Z-PHYTOCHROMOBILIN] == * smiles: ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O...")
 
(Created page with "Category:Gene == Gene Ec-06_002450 == * left end position: ** 1782077 * transcription direction: ** NEGATIVE * right end position: ** 1789149 * centisome position: ** 20.3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYTOCHROMOBILIN 3Z-PHYTOCHROMOBILIN] ==
+
== Gene Ec-06_002450 ==
−
* smiles:
+
* left end position:
−
** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)
+
** 1782077
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DKMLMZVDTGOEGU-AIKFXVFZSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (3Z)-phytochromobilin
+
** 1789149
−
* molecular weight:
+
* centisome position:
−
** 582.655    
+
** 20.348553    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0384_0019
 +
** Esi0384_0019
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
−
* [[1.3.7.4-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1782077}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246013 25246013]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
+
{{#set: right end position=1789149}}
−
{{#set: inchi key=InChIKey=DKMLMZVDTGOEGU-AIKFXVFZSA-L}}
+
{{#set: centisome position=20.348553    }}
−
{{#set: common name=(3Z)-phytochromobilin}}
+
{{#set: common name=Esi_0384_0019|Esi0384_0019}}
−
{{#set: molecular weight=582.655    }}
+
{{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: produced by=1.3.7.4-RXN}}
+
{{#set: pathway associated=PWY-7511}}

Latest revision as of 19:55, 21 March 2018

Gene Ec-06_002450

  • left end position:
    • 1782077
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1789149
  • centisome position:
    • 20.348553
  • Synonym(s):
    • Esi_0384_0019
    • Esi0384_0019

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_002450&oldid=30334"