Difference between revisions of "CPD-11520"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_010570 == * left end position: ** 8898924 * transcription direction: ** NEGATIVE * right end position: ** 8913210 * centisome position: ** 86.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11520 CPD-11520] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11520 CPD-11520] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YYCCMACTOAJGGW-LHVXMLCWSA-J |
| − | * | + | * common name: |
| − | ** | + | ** OPC8-3-ketoacyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1053.904 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-10698]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237200 44237200] | |
| − | {{#set: | + | {{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=YYCCMACTOAJGGW-LHVXMLCWSA-J}} |
| − | {{#set: common name= | + | {{#set: common name=OPC8-3-ketoacyl-CoA}} |
| − | {{#set: | + | {{#set: molecular weight=1053.904 }} |
| − | {{#set: | + | {{#set: produced by=RXN-10698}} |
Latest revision as of 19:56, 21 March 2018
Contents
Metabolite CPD-11520
- smiles:
- CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
- inchi key:
- InChIKey=YYCCMACTOAJGGW-LHVXMLCWSA-J
- common name:
- OPC8-3-ketoacyl-CoA
- molecular weight:
- 1053.904
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.
