Difference between revisions of "RXN1G-4355"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APIGENIN APIGENIN] == * smiles: ** C2(C(C=CC(C1(C(=CC(=CC(O)=1)O)O))=O)=CC=C(C=2)O) * inchi key...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-4355 RXN1G-4355] == * direction: ** LEFT-TO-RIGHT * common name: ** propionyl-CoA carboxylase...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APIGENIN APIGENIN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-4355 RXN1G-4355] ==
−
* smiles:
+
* direction:
−
** C2(C(C=CC(C1(C(=CC(=CC(O)=1)O)O))=O)=CC=C(C=2)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=YQHMWTPYORBCMF-ZZXKWVIFSA-N
+
 
* common name:
 
* common name:
−
** 2',4,4',6'-tetrahydroxychalcone
+
** propionyl-CoA carboxylase, alpha subunit
−
* molecular weight:
+
* ec number:
−
** 272.257   
+
** [http://enzyme.expasy.org/EC/6.4.1.3 EC-6.4.1.3]
 
* Synonym(s):
 
* Synonym(s):
−
** naringenin chalcone
 
−
** chalconaringenin
 
−
** 2'4'6'4-Tetrahydroxychalcone
 
−
** Isosalipurpol
 
−
** tetrahydroxychalcone
 
−
** 3-(4-hydroxyphemyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[APIGNAR-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD1G-277]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[HCO3]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[CPD1G-332]][c] '''+''' 1 [[Pi]][c]
−
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 cerotoyl-CoA[c] '''+''' 1 ATP[c] '''+''' 1 hydrogen carbonate[c] '''=>''' 1 H+[c] '''+''' 1 ADP[c] '''+''' 1 2-carboxy-cerotoyl-CoA[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_010970]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''30''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 73692-50-9
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIPID_MAPS : LMPK12120264
+
{{#set: common name=propionyl-CoA carboxylase, alpha subunit}}
−
* PUBCHEM:
+
{{#set: ec number=EC-6.4.1.3}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280960 5280960]
+
{{#set: gene associated=Ec-01_010970}}
−
* HMDB : HMDB29631
+
{{#set: in pathway=PWYG-321}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06561 C06561]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEMSPIDER:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.chemspider.com/Chemical-Structure.4444447.html 4444447]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15413 15413]
+
−
* METABOLIGHTS : MTBLC15413
+
−
{{#set: smiles=C2(C(C=CC(C1(C(=CC(=CC(O)=1)O)O))=O)=CC=C(C=2)O)}}
+
−
{{#set: inchi key=InChIKey=YQHMWTPYORBCMF-ZZXKWVIFSA-N}}
+
−
{{#set: common name=2',4,4',6'-tetrahydroxychalcone}}
+
−
{{#set: molecular weight=272.257    }}
+
−
{{#set: common name=naringenin chalcone|chalconaringenin|2'4'6'4-Tetrahydroxychalcone|Isosalipurpol|tetrahydroxychalcone|3-(4-hydroxyphemyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one}}
+
−
{{#set: consumed by=APIGNAR-RXN}}
+
−
{{#set: produced by=NARINGENIN-CHALCONE-SYNTHASE-RXN}}
+

Latest revision as of 19:56, 21 March 2018

Reaction RXN1G-4355

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • propionyl-CoA carboxylase, alpha subunit
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 cerotoyl-CoA[c] + 1 ATP[c] + 1 hydrogen carbonate[c] => 1 H+[c] + 1 ADP[c] + 1 2-carboxy-cerotoyl-CoA[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 30 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN1G-4355&oldid=30383"