Difference between revisions of "ALL-TRANS-HEXAPRENYL-DIPHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] == * smiles: ** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALL-TRANS-HEXAPRENYL-DIPHOSPHATE ALL-TRANS-HEXAPRENYL-DIPHOSPHATE] == * smiles: ** CC(C)=CCCC(C...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALL-TRANS-HEXAPRENYL-DIPHOSPHATE ALL-TRANS-HEXAPRENYL-DIPHOSPHATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=NGFSMHKFTZROKJ-MMSZMYIBSA-K |
* common name: | * common name: | ||
− | ** | + | ** all-trans-hexaprenyl diphosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 583.66 |
* Synonym(s): | * Synonym(s): | ||
+ | ** hexaprenyl-diphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-9003]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246217 25246217] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58179 58179] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01230 C01230] |
− | * HMDB : | + | * HMDB : HMDB12188 |
− | {{#set: smiles= | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=NGFSMHKFTZROKJ-MMSZMYIBSA-K}} |
− | {{#set: common name= | + | {{#set: common name=all-trans-hexaprenyl diphosphate}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=583.66 }} |
− | {{#set: | + | {{#set: common name=hexaprenyl-diphosphate}} |
+ | {{#set: consumed by=RXN-9003}} |
Latest revision as of 19:56, 21 March 2018
Contents
Metabolite ALL-TRANS-HEXAPRENYL-DIPHOSPHATE
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]
- inchi key:
- InChIKey=NGFSMHKFTZROKJ-MMSZMYIBSA-K
- common name:
- all-trans-hexaprenyl diphosphate
- molecular weight:
- 583.66
- Synonym(s):
- hexaprenyl-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-" cannot be used as a page name in this wiki.