Difference between revisions of "CPD-6994"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-05_003570 == * Synonym(s): ** Esi_0043_0091 ** Esi0043_0091 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) * in...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-05_003570 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] ==
 +
* smiles:
 +
** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)
 +
* inchi key:
 +
** InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M
 +
* common name:
 +
** (2S)-eriodictyol
 +
* molecular weight:
 +
** 287.248   
 
* Synonym(s):
 
* Synonym(s):
** Esi_0043_0091
 
** Esi0043_0091
 
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-8443]]
+
* [[RXN-7775]]
** [[pantograph]]-[[aragem]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-5381]]
+
 
== External links  ==
 
== External links  ==
{{#set: common name=Esi_0043_0091|Esi0043_0091}}
+
* PUBCHEM:
{{#set: reaction associated=RXN-8443}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657147 90657147]
{{#set: pathway associated=PWY-5381}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28412 28412]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05631 C05631]
 +
* HMDB : HMDB05810
 +
{{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)}}
 +
{{#set: inchi key=InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M}}
 +
{{#set: common name=(2S)-eriodictyol}}
 +
{{#set: molecular weight=287.248    }}
 +
{{#set: consumed by=RXN-7775}}

Latest revision as of 19:56, 21 March 2018

Metabolite CPD-6994

  • smiles:
    • C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)
  • inchi key:
    • InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M
  • common name:
    • (2S)-eriodictyol
  • molecular weight:
    • 287.248
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)" cannot be used as a page name in this wiki.