Difference between revisions of "RXN-14160"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] == * smiles: ** C(CC(=O)C(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=FG...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14160 RXN-14160] == * direction: ** LEFT-TO-RIGHT * common name: ** glycerophosphorylethanolami...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14160 RXN-14160] ==
−
* smiles:
+
* direction:
−
** C(CC(=O)C(=O)[O-])CC(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=FGSBNBBHOZHUBO-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** 2-oxoadipate
+
** glycerophosphorylethanolamine phosphodiesterase
−
* molecular weight:
+
** glycerophosphodiester phosphodiesterase
−
** 158.11   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.1.4.46 EC-3.1.4.46]
 +
** [http://enzyme.expasy.org/EC/3.1.4.2 EC-3.1.4.2]
 
* Synonym(s):
 
* Synonym(s):
−
** 2-ketoadipate
 
−
** α-ketoadipate
 
−
** 2-keto-adipate
 
−
** 2-oxohexanedionic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[L-1-GLYCEROPHOSPHORYLETHANOL-AMINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ETHANOL-AMINE]][c] '''+''' 1 [[GLYCEROL-3P]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[2-AMINOADIPATE-AMINOTRANSFERASE-RXN]]
+
** 1 sn-glycero-3-phosphoethanolamine[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 ethanolamine[c] '''+''' 1 sn-glycerol 3-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-23_002410]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-23_002720]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-7409]], phospholipid remodeling (phosphatidylethanolamine, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7409 PWY-7409]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 3184-35-8
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29320 29320]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615192 23615192]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB00225
+
{{#set: common name=glycerophosphorylethanolamine phosphodiesterase}}
−
* LIGAND-CPD:
+
{{#set: common name=glycerophosphodiester phosphodiesterase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00322 C00322]
+
{{#set: ec number=EC-3.1.4.46}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-3.1.4.2}}
−
** [http://www.chemspider.com/Chemical-Structure.19951093.html 19951093]
+
{{#set: gene associated=Ec-23_002410|Ec-23_002720}}
−
* CHEBI:
+
{{#set: in pathway=PWY-7409}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57499 57499]
+
{{#set: reconstruction category=annotation}}
−
* METABOLIGHTS : MTBLC57499
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=C(CC(=O)C(=O)[O-])CC(=O)[O-]}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=FGSBNBBHOZHUBO-UHFFFAOYSA-L}}
+
−
{{#set: common name=2-oxoadipate}}
+
−
{{#set: molecular weight=158.11    }}
+
−
{{#set: common name=2-ketoadipate|α-ketoadipate|2-keto-adipate|2-oxohexanedionic acid}}
+
−
{{#set: consumed by=2-KETO-ADIPATE-DEHYDROG-RXN}}
+
−
{{#set: consumed or produced by=2-AMINOADIPATE-AMINOTRANSFERASE-RXN}}
+

Latest revision as of 19:04, 21 March 2018

Reaction RXN-14160

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • glycerophosphorylethanolamine phosphodiesterase
    • glycerophosphodiester phosphodiesterase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7409, phospholipid remodeling (phosphatidylethanolamine, yeast): PWY-7409
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-14160&oldid=24309"