Difference between revisions of "Ec-27 005310"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) * inchi key: ** InChIKey=Y...")
 
(Created page with "Category:Gene == Gene Ec-27_005310 == * left end position: ** 4802685 * transcription direction: ** NEGATIVE * right end position: ** 4825664 * centisome position: ** 74.4...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] ==
+
== Gene Ec-27_005310 ==
−
* smiles:
+
* left end position:
−
** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
+
** 4802685
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 7-methylurate
+
** 4825664
−
* molecular weight:
+
* centisome position:
−
** 182.138    
+
** 74.4613    
 
* Synonym(s):
 
* Synonym(s):
−
** 7-methyluric acid
+
** Esi_0000_0226
 +
** Esi0000_0226
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
−
* [[RXN-11521]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4802685}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69160 69160]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=4825664}}
−
** [http://www.chemspider.com/Chemical-Structure.62375.html 62375]
+
{{#set: centisome position=74.4613   }}
−
* CHEBI:
+
{{#set: common name=Esi_0000_0226|Esi0000_0226}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80470 80470]
+
{{#set: reaction associated=ATPASE-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C16355 C16355]
+
−
* HMDB : HMDB11107
+
−
{{#set: smiles=CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))}}
+
−
{{#set: inchi key=InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N}}
+
−
{{#set: common name=7-methylurate}}
+
−
{{#set: molecular weight=182.138   }}
+
−
{{#set: common name=7-methyluric acid}}
+
−
{{#set: produced by=RXN-11521}}
+

Latest revision as of 19:56, 21 March 2018

Gene Ec-27_005310

  • left end position:
    • 4802685
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4825664
  • centisome position:
    • 74.4613
  • Synonym(s):
    • Esi_0000_0226
    • Esi0000_0226

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_005310&oldid=30435"