Difference between revisions of "D-RIBULOSE-15-P2"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NAD-SYNTH-GLN-RXN NAD-SYNTH-GLN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Carbon-nitr...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE-15-P2 D-RIBULOSE-15-P2] == * smiles: ** C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-]...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NAD-SYNTH-GLN-RXN NAD-SYNTH-GLN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE-15-P2 D-RIBULOSE-15-P2] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]
 +
* inchi key:
 +
** InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J
 
* common name:
 
* common name:
−
** Carbon-nitrogen hydrolase
+
** D-ribulose-1,5-bisphosphate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/6.3.5.1 EC-6.3.5.1]
+
** 306.059   
 
* Synonym(s):
 
* Synonym(s):
 +
** ribulose 1,5-bisphosphate
 +
** D-ribulose-1,5-diphosphate
 +
** D-ribulose-1,5-P2
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-961]]
−
** 1 [[ATP]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[GLN]][c] '''+''' 1 [[DEAMIDO-NAD]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[GLT]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PPI]][c]
+
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 ATP[c] '''+''' 1 H2O[c] '''+''' 1 L-glutamine[c] '''+''' 1 nicotinate adenine dinucleotide[c] '''=>''' 1 NAD+[c] '''+''' 1 AMP[c] '''+''' 1 L-glutamate[c] '''+''' 1 H+[c] '''+''' 1 diphosphate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[PHOSPHORIBULOKINASE-RXN]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-14_000810]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-5653]], NAD biosynthesis from 2-amino-3-carboxymuconate semialdehyde: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5653 PWY-5653]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-5381]], pyridine nucleotide cycling (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5381 PWY-5381]
+
−
** '''5''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PYRIDNUCSYN-PWY]], NAD biosynthesis I (from aspartate): [http://metacyc.org/META/NEW-IMAGE?object=PYRIDNUCSYN-PWY PYRIDNUCSYN-PWY]
+
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-7761]], NAD salvage pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7761 PWY-7761]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PYRIDNUCSAL-PWY]], NAD salvage pathway I: [http://metacyc.org/META/NEW-IMAGE?object=PYRIDNUCSAL-PWY PYRIDNUCSAL-PWY]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[aragem]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 14689-84-0
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24384 24384]
+
* PUBCHEM:
−
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615473 23615473]
−
** [http://www.genome.jp/dbget-bin/www_bget?R00257 R00257]
+
* CHEMSPIDER:
−
* UNIPROT:
+
** [http://www.chemspider.com/Chemical-Structure.3541504.html 3541504]
−
** [http://www.uniprot.org/uniprot/Q9PPB0 Q9PPB0]
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/Q9JTY7 Q9JTY7]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57870 57870]
−
** [http://www.uniprot.org/uniprot/Q9CGJ4 Q9CGJ4]
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/Q9Z4V9 Q9Z4V9]
+
** [http://www.genome.jp/dbget-bin/www_bget?C01182 C01182]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]}}
−
{{#set: common name=Carbon-nitrogen hydrolase}}
+
{{#set: inchi key=InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J}}
−
{{#set: ec number=EC-6.3.5.1}}
+
{{#set: common name=D-ribulose-1,5-bisphosphate}}
−
{{#set: gene associated=Ec-14_000810}}
+
{{#set: molecular weight=306.059    }}
−
{{#set: in pathway=PWY-5653|PWY-5381|PYRIDNUCSYN-PWY|PWY-7761|PYRIDNUCSAL-PWY}}
+
{{#set: common name=ribulose 1,5-bisphosphate|D-ribulose-1,5-diphosphate|D-ribulose-1,5-P2}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: consumed by=RXN-961|RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: reversible reaction associated=PHOSPHORIBULOKINASE-RXN}}
−
{{#set: reconstruction source=aragem}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:56, 21 March 2018

Metabolite D-RIBULOSE-15-P2

  • smiles:
    • C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]
  • inchi key:
    • InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J
  • common name:
    • D-ribulose-1,5-bisphosphate
  • molecular weight:
    • 306.059
  • Synonym(s):
    • ribulose 1,5-bisphosphate
    • D-ribulose-1,5-diphosphate
    • D-ribulose-1,5-P2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=D-RIBULOSE-15-P2&oldid=30443"