Difference between revisions of "Ec-08 002720"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-437 CPD1F-437] == * smiles: ** C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO...")
 
(Created page with "Category:Gene == Gene Ec-08_002720 == * left end position: ** 2539920 * transcription direction: ** NEGATIVE * right end position: ** 2553693 * centisome position: ** 37.9...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-437 CPD1F-437] ==
+
== Gene Ec-08_002720 ==
−
* smiles:
+
* left end position:
−
** C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))
+
** 2539920
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OVSQVDMCBVZWGM-QSOFNFLRSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** quercetin-3-glucoside
+
** 2553693
−
* molecular weight:
+
* centisome position:
−
** 463.374    
+
** 37.925865    
 
* Synonym(s):
 
* Synonym(s):
−
** quercetin-3-O-β-D-glucoside
+
** Esi_0007_0222
−
** isoquercetin
+
** Esi0007_0222
−
** isoquercitrin
+
−
** isotrifoliin
+
−
** glucosyl 3-quercetin
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.4.1.101-RXN]]
−
* [[RXN1F-462]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[2.4.1.223-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7426]]
 +
* [[PWY-6558]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2539920}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203368 25203368]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=2553693}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28299 28299]
+
{{#set: centisome position=37.925865   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0007_0222|Esi0007_0222}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05623 C05623]
+
{{#set: reaction associated=2.4.1.101-RXN|2.4.1.223-RXN}}
−
* HMDB : HMDB37362
+
{{#set: pathway associated=PWY-7426|PWY-6558}}
−
{{#set: smiles=C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))}}
+
−
{{#set: inchi key=InChIKey=OVSQVDMCBVZWGM-QSOFNFLRSA-M}}
+
−
{{#set: common name=quercetin-3-glucoside}}
+
−
{{#set: molecular weight=463.374   }}
+
−
{{#set: common name=quercetin-3-O-β-D-glucoside|isoquercetin|isoquercitrin|isotrifoliin|glucosyl 3-quercetin}}
+
−
{{#set: produced by=RXN1F-462}}
+

Latest revision as of 19:57, 21 March 2018

Gene Ec-08_002720

  • left end position:
    • 2539920
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2553693
  • centisome position:
    • 37.925865
  • Synonym(s):
    • Esi_0007_0222
    • Esi0007_0222

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_002720&oldid=30485"