Difference between revisions of "Ec-03 004860"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AN-ALPHA-L-FUCOSIDE AN-ALPHA-L-FUCOSIDE] == * smiles: ** CC1(OC(O[R])C(O)C(O)C(O)1) * common na...")
 
(Created page with "Category:Gene == Gene Ec-03_004860 == * left end position: ** 5777504 * transcription direction: ** POSITIVE * right end position: ** 5791703 * centisome position: ** 88.4...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AN-ALPHA-L-FUCOSIDE AN-ALPHA-L-FUCOSIDE] ==
+
== Gene Ec-03_004860 ==
−
* smiles:
+
* left end position:
−
** CC1(OC(O[R])C(O)C(O)C(O)1)
+
** 5777504
−
* common name:
+
* transcription direction:
−
** α-L-fucoside
+
** POSITIVE
 +
* right end position:
 +
** 5791703
 +
* centisome position:
 +
** 88.49448   
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0050_0076
 +
** Esi0050_0076
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[ALPHA-L-FUCOSIDASE-RXN]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7210]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7184]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=5777504}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02475 C02475]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=5791703}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28349 28349]
+
{{#set: centisome position=88.49448    }}
−
{{#set: smiles=CC1(OC(O[R])C(O)C(O)C(O)1)}}
+
{{#set: common name=Esi_0050_0076|Esi0050_0076}}
−
{{#set: common name=α-L-fucoside}}
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
{{#set: consumed by=ALPHA-L-FUCOSIDASE-RXN}}
+
{{#set: pathway associated=PWY-7210|PWY-7198|PWY-6545|PWY-7184}}

Latest revision as of 19:57, 21 March 2018

Gene Ec-03_004860

  • left end position:
    • 5777504
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5791703
  • centisome position:
    • 88.49448
  • Synonym(s):
    • Esi_0050_0076
    • Esi0050_0076

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_004860&oldid=30488"