Difference between revisions of "Ec-03 004860"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AN-ALPHA-L-FUCOSIDE AN-ALPHA-L-FUCOSIDE] == * smiles: ** CC1(OC(O[R])C(O)C(O)C(O)1) * common na...") |
(Created page with "Category:Gene == Gene Ec-03_004860 == * left end position: ** 5777504 * transcription direction: ** POSITIVE * right end position: ** 5791703 * centisome position: ** 88.4...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-03_004860 == |
− | * | + | * left end position: |
− | ** | + | ** 5777504 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
+ | * right end position: | ||
+ | ** 5791703 | ||
+ | * centisome position: | ||
+ | ** 88.49448 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0050_0076 | ||
+ | ** Esi0050_0076 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ATPASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | * Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-12195]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-12196]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN0-5462]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7210]] | ||
+ | * [[PWY-7198]] | ||
+ | * [[PWY-6545]] | ||
+ | * [[PWY-7184]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5777504}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5791703}} | |
− | + | {{#set: centisome position=88.49448 }} | |
− | {{#set: | + | {{#set: common name=Esi_0050_0076|Esi0050_0076}} |
− | {{#set: common name= | + | {{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}} |
− | {{#set: | + | {{#set: pathway associated=PWY-7210|PWY-7198|PWY-6545|PWY-7184}} |
Latest revision as of 19:57, 21 March 2018
Gene Ec-03_004860
- left end position:
- 5777504
- transcription direction:
- POSITIVE
- right end position:
- 5791703
- centisome position:
- 88.49448
- Synonym(s):
- Esi_0050_0076
- Esi0050_0076
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: NUCLEOSIDE-TRIPHOSPHATASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12195
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12196
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN0-5462
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome