Difference between revisions of "AN-ALPHA-L-FUCOSIDE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_007830 == * left end position: ** 6677504 * transcription direction: ** NEGATIVE * right end position: ** 6681176 * centisome position: ** 64.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AN-ALPHA-L-FUCOSIDE AN-ALPHA-L-FUCOSIDE] == * smiles: ** CC1(OC(O[R])C(O)C(O)C(O)1) * common na...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AN-ALPHA-L-FUCOSIDE AN-ALPHA-L-FUCOSIDE] == |
− | * | + | * smiles: |
− | ** | + | ** CC1(OC(O[R])C(O)C(O)C(O)1) |
− | * | + | * common name: |
− | ** | + | ** α-L-fucoside |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[ALPHA-L-FUCOSIDASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02475 C02475] | |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28349 28349] |
− | {{#set: common name= | + | {{#set: smiles=CC1(OC(O[R])C(O)C(O)C(O)1)}} |
− | + | {{#set: common name=α-L-fucoside}} | |
− | {{#set: | + | {{#set: consumed by=ALPHA-L-FUCOSIDASE-RXN}} |
Latest revision as of 20:57, 21 March 2018
Contents
Metabolite AN-ALPHA-L-FUCOSIDE
- smiles:
- CC1(OC(O[R])C(O)C(O)C(O)1)
- common name:
- α-L-fucoside
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(OC(O[R])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.