Difference between revisions of "Ec-18 004660"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-HYDROXYPYRUVATE 3-P-HYDROXYPYRUVATE] == * smiles: ** C(OP([O-])(=O)[O-])C(=O)C(=O)[O-] * in...") |
(Created page with "Category:Gene == Gene Ec-18_004660 == * left end position: ** 4776470 * transcription direction: ** POSITIVE * right end position: ** 4836198 * centisome position: ** 96.9...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-18_004660 == |
− | * | + | * left end position: |
− | ** | + | ** 4776470 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4836198 |
− | * | + | * centisome position: |
− | ** | + | ** 96.953514 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0066_0108 |
− | ** | + | ** Esi0066_0108 |
− | ** | + | ** DYHC8 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ATPASE-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
− | * [[ | + | * Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-12195]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-12196]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN0-5462]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7210]] | ||
+ | * [[PWY-7198]] | ||
+ | * [[PWY-6545]] | ||
+ | * [[PWY-7184]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4776470}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4836198}} | |
− | + | {{#set: centisome position=96.953514 }} | |
− | + | {{#set: common name=Esi_0066_0108|Esi0066_0108|DYHC8}} | |
− | + | {{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}} | |
− | + | {{#set: pathway associated=PWY-7210|PWY-7198|PWY-6545|PWY-7184}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:57, 21 March 2018
Gene Ec-18_004660
- left end position:
- 4776470
- transcription direction:
- POSITIVE
- right end position:
- 4836198
- centisome position:
- 96.953514
- Synonym(s):
- Esi_0066_0108
- Esi0066_0108
- DYHC8
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: NUCLEOSIDE-TRIPHOSPHATASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12195
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12196
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN0-5462
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome