Difference between revisions of "SPERMINE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-08_002720 == * left end position: ** 2539920 * transcription direction: ** NEGATIVE * right end position: ** 2553693 * centisome position: ** 37.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMINE SPERMINE] == * smiles: ** C(CCC[N+]CCC[N+])[N+]CCC[N+] * inchi key: ** InChIKey=PFNFFQ...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMINE SPERMINE] == |
− | * | + | * smiles: |
− | ** | + | ** C(CCC[N+]CCC[N+])[N+]CCC[N+] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PFNFFQXMRSDOHW-UHFFFAOYSA-R |
− | * | + | * common name: |
− | ** | + | ** spermine |
− | * | + | * molecular weight: |
− | ** | + | ** 206.374 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** gerontine |
− | ** | + | ** musculamine |
+ | ** neuridine | ||
+ | ** diaminopropyl-tetramethylenediamine | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[SPERMINE-SYNTHASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 71-44-3 |
− | {{#set: | + | * DRUGBANK : DB02564 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=446718 446718] |
− | {{#set: common name= | + | * HMDB : HMDB01256 |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00750 C00750] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.394003.html 394003] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45725 45725] | ||
+ | * METABOLIGHTS : MTBLC45725 | ||
+ | {{#set: smiles=C(CCC[N+]CCC[N+])[N+]CCC[N+]}} | ||
+ | {{#set: inchi key=InChIKey=PFNFFQXMRSDOHW-UHFFFAOYSA-R}} | ||
+ | {{#set: common name=spermine}} | ||
+ | {{#set: molecular weight=206.374 }} | ||
+ | {{#set: common name=gerontine|musculamine|neuridine|diaminopropyl-tetramethylenediamine}} | ||
+ | {{#set: produced by=SPERMINE-SYNTHASE-RXN}} |
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite SPERMINE
- smiles:
- C(CCC[N+]CCC[N+])[N+]CCC[N+]
- inchi key:
- InChIKey=PFNFFQXMRSDOHW-UHFFFAOYSA-R
- common name:
- spermine
- molecular weight:
- 206.374
- Synonym(s):
- gerontine
- musculamine
- neuridine
- diaminopropyl-tetramethylenediamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 71-44-3
- DRUGBANK : DB02564
- PUBCHEM:
- HMDB : HMDB01256
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC45725
"C(CCC[N+]CCC[N+])[N+]CCC[N+" cannot be used as a page name in this wiki.