Difference between revisions of "PRECURSOR-Z"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-06_007320 == * left end position: ** 5016711 * transcription direction: ** POSITIVE * right end position: ** 5035682 * centisome position: ** 57.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRECURSOR-Z PRECURSOR-Z] == * smiles: ** C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRECURSOR-Z PRECURSOR-Z] == |
− | * | + | * smiles: |
− | ** | + | ** C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(N)NC(=O)4)))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PWFXLXMPGSLEOZ-QQVWSJFJSA-M |
− | * | + | * common name: |
− | ** | + | ** cyclic pyranopterin phosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 344.2 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** precursor Z |
− | ** | + | ** cPMP |
+ | ** precursor-Z | ||
+ | ** 8-amino-2,12,12-trihydroxy-4a,5a,6,9,11,11a,12,12a-octahydro[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridin-10(4H)-one 2-oxide | ||
+ | ** 8-amino-2,12,12-trihydroxy-4,4a,5a,6,9,10,11,11a,12,12a-decahydro-[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridine 2-oxide | ||
+ | ** cyclic pyranopterin monophosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-8342]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-8340]] | |
− | * [[RXN- | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659039 90659039] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59648 59648] |
− | {{#set: common name= | + | {{#set: smiles=C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(N)NC(=O)4))))}} |
− | + | {{#set: inchi key=InChIKey=PWFXLXMPGSLEOZ-QQVWSJFJSA-M}} | |
− | {{#set: | + | {{#set: common name=cyclic pyranopterin phosphate}} |
+ | {{#set: molecular weight=344.2 }} | ||
+ | {{#set: common name=precursor Z|cPMP|precursor-Z|8-amino-2,12,12-trihydroxy-4a,5a,6,9,11,11a,12,12a-octahydro[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridin-10(4H)-one 2-oxide|8-amino-2,12,12-trihydroxy-4,4a,5a,6,9,10,11,11a,12,12a-decahydro-[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridine 2-oxide|cyclic pyranopterin monophosphate}} | ||
+ | {{#set: consumed by=RXN-8342}} | ||
+ | {{#set: produced by=RXN-8340}} |
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite PRECURSOR-Z
- smiles:
- C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(N)NC(=O)4))))
- inchi key:
- InChIKey=PWFXLXMPGSLEOZ-QQVWSJFJSA-M
- common name:
- cyclic pyranopterin phosphate
- molecular weight:
- 344.2
- Synonym(s):
- precursor Z
- cPMP
- precursor-Z
- 8-amino-2,12,12-trihydroxy-4a,5a,6,9,11,11a,12,12a-octahydro[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridin-10(4H)-one 2-oxide
- 8-amino-2,12,12-trihydroxy-4,4a,5a,6,9,10,11,11a,12,12a-decahydro-[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridine 2-oxide
- cyclic pyranopterin monophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(N)NC(=O)4))))" cannot be used as a page name in this wiki.
- "8-amino-2,12,12-trihydroxy-4a,5a,6,9,11,11a,12,12a-octahydro[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridin-10(4H)-one 2-oxide" cannot be used as a page name in this wiki.
- "8-amino-2,12,12-trihydroxy-4,4a,5a,6,9,10,11,11a,12,12a-decahydro-[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridine 2-oxide" cannot be used as a page name in this wiki.