Difference between revisions of "Ec-11 000140"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1) * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-11_000140 == * left end position: ** 196937 * transcription direction: ** NEGATIVE * right end position: ** 201891 * centisome position: ** 3.1311...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-11_000140 == |
− | * | + | * left end position: |
− | ** | + | ** 196937 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 201891 |
− | * | + | * centisome position: |
− | ** | + | ** 3.131124 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0113_0006 |
+ | ** Esi0113_0006 | ||
+ | ** 3HIDH | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: ec-number | |
− | + | == Pathways associated == | |
− | * [[ | + | * [[VALDEG-PWY]] |
− | * | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=196937}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=201891}} | |
− | + | {{#set: centisome position=3.131124 }} | |
− | + | {{#set: common name=Esi_0113_0006|Esi0113_0006|3HIDH}} | |
− | + | {{#set: reaction associated=3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN}} | |
− | + | {{#set: pathway associated=VALDEG-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:57, 21 March 2018
Gene Ec-11_000140
- left end position:
- 196937
- transcription direction:
- NEGATIVE
- right end position:
- 201891
- centisome position:
- 3.131124
- Synonym(s):
- Esi_0113_0006
- Esi0113_0006
- 3HIDH
Reactions associated
- Reaction: 3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome