Difference between revisions of "CPD-7004"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12570 RXN-12570] == * direction: ** LEFT-TO-RIGHT * common name: ** 6-phosphogluconate dehydrog...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12570 RXN-12570] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
 +
* inchi key:
 +
** InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M
 
* common name:
 
* common name:
−
** 6-phosphogluconate dehydrogenase, C-terminal-like
+
** dihydrogeranylgeranyl chlorophyll a
−
** 3-hydroxyacyl-CoA dehydrogenase
+
* molecular weight:
−
* ec number:
+
** 888.463   
−
** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** dihydrogeranylgeranyl-chl a
 +
** dihydroGG-chl a
 +
** dihydroGG-chlorophyll a
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7665]]
−
** 1 [[K-HEXANOYL-COA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[OH-HEXANOYL-COA]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-7664]]
−
** 1 3-oxohexanoyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 (S)-3-hydroxyhexanoyl-CoA[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-19_005290]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-14_006530]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-6863]], pyruvate fermentation to hexanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863]
+
−
** '''7''' reactions found over '''11''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[aragem]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31144 31144]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926294 46926294]
−
* LIGAND-RXN:
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R04748 R04748]
+
{{#set: inchi key=InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=dihydrogeranylgeranyl chlorophyll a}}
−
{{#set: common name=6-phosphogluconate dehydrogenase, C-terminal-like}}
+
{{#set: molecular weight=888.463    }}
−
{{#set: common name=3-hydroxyacyl-CoA dehydrogenase}}
+
{{#set: common name=dihydrogeranylgeranyl-chl a|dihydroGG-chl a|dihydroGG-chlorophyll a}}
−
{{#set: ec number=EC-1.1.1.35}}
+
{{#set: consumed by=RXN-7665}}
−
{{#set: gene associated=Ec-19_005290|Ec-14_006530}}
+
{{#set: produced by=RXN-7664}}
−
{{#set: in pathway=PWY-6863}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=aragem}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:58, 21 March 2018

Metabolite CPD-7004

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • inchi key:
    • InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M
  • common name:
    • dihydrogeranylgeranyl chlorophyll a
  • molecular weight:
    • 888.463
  • Synonym(s):
    • dihydrogeranylgeranyl-chl a
    • dihydroGG-chl a
    • dihydroGG-chlorophyll a

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-7004&oldid=30606"