Difference between revisions of "RXN-15271"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15271 RXN-15271] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15271 RXN-15271] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.99.1 EC-2.4.99.1] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[B-Gal-14-NacGlc-R]][c] '''+''' 1 [[CMP-N-ACETYL-NEURAMINATE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CMP]][c] '''+''' 1 [[CPD-16483]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R[c] '''+''' 1 CMP-N-acetyl-β-neuraminate[c] '''=>''' 1 H+[c] '''+''' 1 CMP[c] '''+''' 1 α-N-acetylneuraminyl-2,6-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-7434]], terminal O-glycans residues modification: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7434 PWY-7434] | ||
+ | ** '''10''' reactions found over '''10''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-2.4.99.1}} | |
− | + | {{#set: in pathway=PWY-7434}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:58, 21 March 2018
Contents
Reaction RXN-15271
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 B-Gal-14-NacGlc-R[c] + 1 CMP-N-ACETYL-NEURAMINATE[c] => 1 PROTON[c] + 1 CMP[c] + 1 CPD-16483[c]
- With common name(s):
- 1 β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R[c] + 1 CMP-N-acetyl-β-neuraminate[c] => 1 H+[c] + 1 CMP[c] + 1 α-N-acetylneuraminyl-2,6-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R[c]
Genes associated with this reaction
Pathways
- PWY-7434, terminal O-glycans residues modification: PWY-7434
- 10 reactions found over 10 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome