Difference between revisions of "CPD-17894"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17346 CPD-17346] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C |
− | + | ||
− | + | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=MBYVKTIIZNUHKN-NIVAAIEQSA-M |
+ | * common name: | ||
+ | ** β-D-mannosyl-(C55 ω-saturated dolichyl phosphate) | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1012.461 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-16602]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820528 91820528] |
− | + | {{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C}} | |
− | + | {{#set: inchi key=InChIKey=MBYVKTIIZNUHKN-NIVAAIEQSA-M}} | |
− | {{#set: smiles= | + | {{#set: common name=β-D-mannosyl-(C55 ω-saturated dolichyl phosphate)}} |
− | {{#set: | + | {{#set: molecular weight=1012.461 }} |
− | {{#set: | + | {{#set: produced by=RXN-16602}} |
− | {{#set: molecular weight= | + | |
− | + | ||
− | {{#set: produced by=RXN- | + |
Latest revision as of 19:58, 21 March 2018
Contents
Metabolite CPD-17894
- smiles:
- CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C
- inchi key:
- InChIKey=MBYVKTIIZNUHKN-NIVAAIEQSA-M
- common name:
- β-D-mannosyl-(C55 ω-saturated dolichyl phosphate)
- molecular weight:
- 1012.461
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C" cannot be used as a page name in this wiki.