Difference between revisions of "Ec-01 007190"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4081 CPD-4081] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2C...")
 
(Created page with "Category:Gene == Gene Ec-01_007190 == * left end position: ** 6140234 * transcription direction: ** POSITIVE * right end position: ** 6157420 * centisome position: ** 59.5...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4081 CPD-4081] ==
+
== Gene Ec-01_007190 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** 6140234
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4α-methyl-5α-ergosta-8,24-dien-3β-ol
+
** 6157420
−
* molecular weight:
+
* centisome position:
−
** 412.698    
+
** 59.505116    
 
* Synonym(s):
 
* Synonym(s):
−
** 4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol
+
** Esi_0002_0198
−
** 4α-methyl-5α-ergosta-8,24-dien-3β-ol
+
** Esi0002_0198
−
** 4α-methylfecosterol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
−
* [[RXN-4144]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=6140234}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=193524 193524]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=6157420}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80094 80094]
+
{{#set: centisome position=59.505116   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0002_0198|Esi0002_0198}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15776 C15776]
+
{{#set: reaction associated=ATPASE-RXN}}
−
* HMDB : HMDB06845
+
−
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N}}
+
−
{{#set: common name=4α-methyl-5α-ergosta-8,24-dien-3β-ol}}
+
−
{{#set: molecular weight=412.698   }}
+
−
{{#set: common name=4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol|4α-methyl-5α-ergosta-8,24-dien-3β-ol|4α-methylfecosterol}}
+
−
{{#set: produced by=RXN-4144}}
+

Latest revision as of 19:58, 21 March 2018

Gene Ec-01_007190

  • left end position:
    • 6140234
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6157420
  • centisome position:
    • 59.505116
  • Synonym(s):
    • Esi_0002_0198
    • Esi0002_0198

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_007190&oldid=30681"