Difference between revisions of "ADENOSYL-P4"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-23_003230 == * left end position: ** 3498039 * transcription direction: ** POSITIVE * right end position: ** 3502228 * centisome position: ** 72.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYL-P4 ADENOSYL-P4] == * smiles: ** C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(O...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYL-P4 ADENOSYL-P4] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(OP(OCC4(C(C(C(O4)N6(C=NC5(C(=NC=NC=56)N)))O)O))([O-])=O)([O-])=O)([O-])=O)([O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YOAHKNVSNCMZGQ-XPWFQUROSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 5',5'''-diadenosine tetraphosphate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 832.36 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Ap4A |
| − | ** | + | ** AppppA |
| + | ** P(1),P(4)-bis(5'-adenosyl)tetraphosphate | ||
| + | ** P1,P4-bis(5'-adenosyl)tetraphosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[ATP-ADENYLYLTRANSFERASE-RXN]] | |
| − | == | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * BIGG : 1484745 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243905 25243905] |
| − | {{#set: | + | * HMDB : HMDB01211 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01260 C01260] | |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58141 58141] | ||
| + | * METABOLIGHTS : MTBLC58141 | ||
| + | {{#set: smiles=C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(OP(OCC4(C(C(C(O4)N6(C=NC5(C(=NC=NC=56)N)))O)O))([O-])=O)([O-])=O)([O-])=O)([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=YOAHKNVSNCMZGQ-XPWFQUROSA-J}} | ||
| + | {{#set: common name=5',5'''-diadenosine tetraphosphate}} | ||
| + | {{#set: molecular weight=832.36 }} | ||
| + | {{#set: common name=Ap4A|AppppA|P(1),P(4)-bis(5'-adenosyl)tetraphosphate|P1,P4-bis(5'-adenosyl)tetraphosphate}} | ||
| + | {{#set: reversible reaction associated=ATP-ADENYLYLTRANSFERASE-RXN}} | ||
Latest revision as of 19:58, 21 March 2018
Contents
Metabolite ADENOSYL-P4
- smiles:
- C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(OP(OCC4(C(C(C(O4)N6(C=NC5(C(=NC=NC=56)N)))O)O))([O-])=O)([O-])=O)([O-])=O)([O-])=O
- inchi key:
- InChIKey=YOAHKNVSNCMZGQ-XPWFQUROSA-J
- common name:
- 5',5-diadenosine tetraphosphate
- molecular weight:
- 832.36
- Synonym(s):
- Ap4A
- AppppA
- P(1),P(4)-bis(5'-adenosyl)tetraphosphate
- P1,P4-bis(5'-adenosyl)tetraphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 1484745
- PUBCHEM:
- HMDB : HMDB01211
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58141
"C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(OP(OCC4(C(C(C(O4)N6(C=NC5(C(=NC=NC=56)N)))O)O))([O-])=O)([O-])=O)([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
