Difference between revisions of "Ec-24 000110"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMP DIMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi ke...") |
(Created page with "Category:Gene == Gene Ec-24_000110 == * left end position: ** 227567 * transcription direction: ** NEGATIVE * right end position: ** 254329 * centisome position: ** 4.5625...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-24_000110 == |
− | * | + | * left end position: |
− | ** | + | ** 227567 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 254329 |
− | * | + | * centisome position: |
− | ** | + | ** 4.5625896 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0178_0028 |
− | ** | + | ** Esi0178_0028 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[CARBOXYPEPTIDASE-A-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=227567}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=254329}} | |
− | + | {{#set: centisome position=4.5625896 }} | |
− | + | {{#set: common name=Esi_0178_0028|Esi0178_0028}} | |
− | + | {{#set: reaction associated=CARBOXYPEPTIDASE-A-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:58, 21 March 2018
Gene Ec-24_000110
- left end position:
- 227567
- transcription direction:
- NEGATIVE
- right end position:
- 254329
- centisome position:
- 4.5625896
- Synonym(s):
- Esi_0178_0028
- Esi0178_0028
Reactions associated
- Reaction: CARBOXYPEPTIDASE-A-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome