Difference between revisions of "Ec-24 001300"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] == * smiles: ** C1(=CC=C(C=C1)[N+]([O-])=O) * inchi key: ** InChIKey=L...") |
(Created page with "Category:Gene == Gene Ec-24_001300 == * left end position: ** 1469840 * transcription direction: ** NEGATIVE * right end position: ** 1480728 * centisome position: ** 29.4...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-24_001300 == |
− | * | + | * left end position: |
− | ** | + | ** 1469840 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1480728 |
− | * | + | * centisome position: |
− | ** | + | ** 29.46946 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0019_0171 |
− | ** | + | ** Esi0019_0171 |
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1469840}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1480728}} | |
− | + | {{#set: centisome position=29.46946 }} | |
− | + | {{#set: common name=Esi_0019_0171|Esi0019_0171}} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:58, 21 March 2018
Gene Ec-24_001300
- left end position:
- 1469840
- transcription direction:
- NEGATIVE
- right end position:
- 1480728
- centisome position:
- 29.46946
- Synonym(s):
- Esi_0019_0171
- Esi0019_0171
Reactions associated
- Reaction: DNA-DIRECTED-RNA-POLYMERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome