Difference between revisions of "8-AMINO-7-OXONONANOATE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=SUCUTIL-PWY SUCUTIL-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * in...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(C(CCCCCC([O-])=O)=O)[N+] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 8-amino-7-oxononanoate |
| + | * molecular weight: | ||
| + | ** 187.238 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 7-keto-8-aminopelargonate | ||
| + | ** KAPA | ||
| + | ** 7-KAP | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[7KAPSYN-RXN]] | |
| − | == Reaction(s) | + | * [[RXN-11484]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[DAPASYN-RXN]] | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01092 C01092] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57532 57532] |
| − | {{#set: | + | * BIGG : 36792 |
| − | {{#set: reaction | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244029 25244029] | ||
| + | * HMDB : HMDB37790 | ||
| + | {{#set: smiles=CC(C(CCCCCC([O-])=O)=O)[N+]}} | ||
| + | {{#set: inchi key=InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=8-amino-7-oxononanoate}} | ||
| + | {{#set: molecular weight=187.238 }} | ||
| + | {{#set: common name=7-keto-8-aminopelargonate|KAPA|7-KAP}} | ||
| + | {{#set: produced by=7KAPSYN-RXN|RXN-11484}} | ||
| + | {{#set: reversible reaction associated=DAPASYN-RXN}} | ||
Latest revision as of 19:04, 21 March 2018
Contents
Metabolite 8-AMINO-7-OXONONANOATE
- smiles:
- CC(C(CCCCCC([O-])=O)=O)[N+]
- inchi key:
- InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N
- common name:
- 8-amino-7-oxononanoate
- molecular weight:
- 187.238
- Synonym(s):
- 7-keto-8-aminopelargonate
- KAPA
- 7-KAP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(CCCCCC([O-])=O)=O)[N+" cannot be used as a page name in this wiki.
