Difference between revisions of "DIMP"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-12_001780 == * left end position: ** 1702363 * transcription direction: ** POSITIVE * right end position: ** 1704119 * centisome position: ** 20.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMP DIMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi ke...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMP DIMP] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=PHNGFPPXDJJADG-RRKCRQDMSA-L |
| − | * | + | * common name: |
| − | ** | + | ** dIMP |
| − | * | + | * molecular weight: |
| − | ** | + | ** 330.193 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2'-deoxy-IMP |
| − | ** | + | ** 2'-deoxy-5'-inosinic acid |
| + | ** 2'-Deoxyinosine 5'-monophosphate | ||
| + | ** 2'-Deoxyinosine 5'-phosphate | ||
| + | ** 9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-9H-purin-6-ol | ||
| + | ** Deoxyinosine monophosphate | ||
| + | ** Hypoxanthine deoxyriboside | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN0-1602]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * BIGG : 47635 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22841129 22841129] |
| − | {{#set: | + | * HMDB : HMDB06555 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06196 C06196] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.18596798.html 18596798] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61194 61194] | ||
| + | * METABOLIGHTS : MTBLC61194 | ||
| + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}} | ||
| + | {{#set: inchi key=InChIKey=PHNGFPPXDJJADG-RRKCRQDMSA-L}} | ||
| + | {{#set: common name=dIMP}} | ||
| + | {{#set: molecular weight=330.193 }} | ||
| + | {{#set: common name=2'-deoxy-IMP|2'-deoxy-5'-inosinic acid|2'-Deoxyinosine 5'-monophosphate|2'-Deoxyinosine 5'-phosphate|9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-9H-purin-6-ol|Deoxyinosine monophosphate|Hypoxanthine deoxyriboside}} | ||
| + | {{#set: produced by=RXN0-1602}} | ||
Latest revision as of 19:58, 21 March 2018
Contents
Metabolite DIMP
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
- inchi key:
- InChIKey=PHNGFPPXDJJADG-RRKCRQDMSA-L
- common name:
- dIMP
- molecular weight:
- 330.193
- Synonym(s):
- 2'-deoxy-IMP
- 2'-deoxy-5'-inosinic acid
- 2'-Deoxyinosine 5'-monophosphate
- 2'-Deoxyinosine 5'-phosphate
- 9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-9H-purin-6-ol
- Deoxyinosine monophosphate
- Hypoxanthine deoxyriboside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 47635
- PUBCHEM:
- HMDB : HMDB06555
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC61194
"C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.
