Difference between revisions of "Ec-02 001880"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=...")
 
(Created page with "Category:Gene == Gene Ec-02_001880 == * left end position: ** 2155523 * transcription direction: ** POSITIVE * right end position: ** 2162633 * centisome position: ** 33.0...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] ==
+
== Gene Ec-02_001880 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
+
** 2155523
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 8-oxo-dGMP
+
** 2162633
−
* molecular weight:
+
* centisome position:
−
** 361.207    
+
** 33.02071    
 
* Synonym(s):
 
* Synonym(s):
−
** 8-oxo-7,8-dihydro-2'-dGMP
+
** Esi_0055_0078
−
** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate
+
** Esi0055_0078
−
** 8-oxo-deoxyguanosine-monophosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PEROXID-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-14205]]
+
*** Assignment: go-term
 +
* Reaction: [[RXN-14240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-15288]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-17352]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-8635]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7214]]
 +
* [[PWY-6824]]
 +
* [[PWY-7445]]
 +
* [[PWY-5469]]
 +
* [[PWY-5466]]
 +
* [[PWY-5461]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2155523}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173535 46173535]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2162633}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63224 63224]
+
{{#set: centisome position=33.02071   }}
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: common name=Esi_0055_0078|Esi0055_0078}}
−
{{#set: inchi key=InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L}}
+
{{#set: reaction associated=PEROXID-RXN|RXN-14240|RXN-15288|RXN-17352|RXN-8635}}
−
{{#set: common name=8-oxo-dGMP}}
+
{{#set: pathway associated=PWY-7214|PWY-6824|PWY-7445|PWY-5469|PWY-5466|PWY-5461}}
−
{{#set: molecular weight=361.207   }}
+
−
{{#set: common name=8-oxo-7,8-dihydro-2'-dGMP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate|8-oxo-deoxyguanosine-monophosphate}}
+
−
{{#set: consumed or produced by=RXN-14205}}
+

Latest revision as of 19:58, 21 March 2018

Gene Ec-02_001880

  • left end position:
    • 2155523
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2162633
  • centisome position:
    • 33.02071
  • Synonym(s):
    • Esi_0055_0078
    • Esi0055_0078

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-02_001880&oldid=30721"