Difference between revisions of "Ec-16 002130"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-497 CPD-497] == * smiles: ** C1(=C(C(=O)NC(=O)N1)C2(OC(CO)C(O)C(O)2)) * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Ec-16_002130 == * left end position: ** 2330466 * transcription direction: ** NEGATIVE * right end position: ** 2339795 * centisome position: ** 43.6...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-16_002130 == |
− | * | + | * left end position: |
− | ** | + | ** 2330466 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2339795 |
− | * | + | * centisome position: |
− | ** | + | ** 43.660866 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0047_0053 | ||
+ | ** Esi0047_0053 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.7.11.4-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2330466}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2339795}} | |
− | + | {{#set: centisome position=43.660866 }} | |
− | + | {{#set: common name=Esi_0047_0053|Esi0047_0053}} | |
− | + | {{#set: reaction associated=2.7.11.4-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:58, 21 March 2018
Gene Ec-16_002130
- left end position:
- 2330466
- transcription direction:
- NEGATIVE
- right end position:
- 2339795
- centisome position:
- 43.660866
- Synonym(s):
- Esi_0047_0053
- Esi0047_0053
Reactions associated
- Reaction: 2.7.11.4-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome