Difference between revisions of "Ec-27 004000"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARIN COUMARIN] == * smiles: ** C1(OC2(=CC=CC=C(C=C1)2))=O * inchi key: ** InChIKey=ZYGHJZDH...") |
(Created page with "Category:Gene == Gene Ec-27_004000 == * left end position: ** 3492111 * transcription direction: ** NEGATIVE * right end position: ** 3494381 * centisome position: ** 54.1...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-27_004000 == |
− | * | + | * left end position: |
− | ** | + | ** 3492111 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3494381 |
− | * | + | * centisome position: |
− | ** | + | ** 54.142033 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0000_0454 |
− | ** | + | ** Esi0000_0454 |
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2PGADEHYDRAT-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
+ | * [[PWY-1042]] | ||
+ | * [[P341-PWY]] | ||
+ | * [[PWY-2221]] | ||
+ | * [[PWY-1622]] | ||
+ | * [[GLUCONEO-PWY]] | ||
+ | * [[PWY-7003]] | ||
+ | * [[PWY-6901]] | ||
+ | * [[PWY-7218]] | ||
+ | * [[NPGLUCAT-PWY]] | ||
+ | * [[P124-PWY]] | ||
+ | * [[GLYCOLYSIS]] | ||
+ | * [[ANAGLYCOLYSIS-PWY]] | ||
+ | * [[PWY-5723]] | ||
+ | * [[PWY-6142]] | ||
+ | * [[P122-PWY]] | ||
+ | * [[PWY-7124]] | ||
+ | * [[PWY-6886]] | ||
+ | * [[PWY-5484]] | ||
+ | * [[PWY66-399]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3492111}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3494381}} | |
− | + | {{#set: centisome position=54.142033 }} | |
− | + | {{#set: common name=Esi_0000_0454|Esi0000_0454}} | |
− | + | {{#set: reaction associated=2PGADEHYDRAT-RXN}} | |
− | + | {{#set: pathway associated=PWY-1042|P341-PWY|PWY-2221|PWY-1622|GLUCONEO-PWY|PWY-7003|PWY-6901|PWY-7218|NPGLUCAT-PWY|P124-PWY|GLYCOLYSIS|ANAGLYCOLYSIS-PWY|PWY-5723|PWY-6142|P122-PWY|PWY-7124|PWY-6886|PWY-5484|PWY66-399}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:59, 21 March 2018
Gene Ec-27_004000
- left end position:
- 3492111
- transcription direction:
- NEGATIVE
- right end position:
- 3494381
- centisome position:
- 54.142033
- Synonym(s):
- Esi_0000_0454
- Esi0000_0454
Reactions associated
- Reaction: 2PGADEHYDRAT-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
Pathways associated
- PWY-1042
- P341-PWY
- PWY-2221
- PWY-1622
- GLUCONEO-PWY
- PWY-7003
- PWY-6901
- PWY-7218
- NPGLUCAT-PWY
- P124-PWY
- GLYCOLYSIS
- ANAGLYCOLYSIS-PWY
- PWY-5723
- PWY-6142
- P122-PWY
- PWY-7124
- PWY-6886
- PWY-5484
- PWY66-399