Difference between revisions of "Ec-02 000280"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == * smiles: ** C([N+])CCCC([N+])C([O-])=O * inchi key: ** InChIKey=KDXKERNSBIXSRK-YFK...") |
(Created page with "Category:Gene == Gene Ec-02_000280 == * left end position: ** 279080 * transcription direction: ** NEGATIVE * right end position: ** 284171 * centisome position: ** 4.2752...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-02_000280 == |
− | * | + | * left end position: |
− | ** | + | ** 279080 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 284171 |
− | * | + | * centisome position: |
− | ** | + | ** 4.2752595 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0083_0048 |
− | ** | + | ** Esi0083_0048 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * | + | *** Assignment: go-term |
− | * [[ | + | == Pathways associated == |
− | + | ||
− | * | + | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=279080}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=284171}} | |
− | + | {{#set: centisome position=4.2752595 }} | |
− | + | {{#set: common name=Esi_0083_0048|Esi0083_0048}} | |
− | + | {{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:59, 21 March 2018
Gene Ec-02_000280
- left end position:
- 279080
- transcription direction:
- NEGATIVE
- right end position:
- 284171
- centisome position:
- 4.2752595
- Synonym(s):
- Esi_0083_0048
- Esi0083_0048
Reactions associated
- Reaction: NAD+-ADP-RIBOSYLTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome