Difference between revisions of "Ec-14 006550"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * smiles: ** C1(NC=NC=1CC(C(=O)[O-])[N+]) * inchi key: ** InChIKey=HNDVDQJCIGZPNO-Y...") |
(Created page with "Category:Gene == Gene Ec-14_006550 == * left end position: ** 6057204 * transcription direction: ** POSITIVE * right end position: ** 6062313 * centisome position: ** 92.3...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-14_006550 == |
− | * | + | * left end position: |
− | ** | + | ** 6057204 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 6062313 |
− | * | + | * centisome position: |
− | ** | + | ** 92.3294 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0063_0045 |
− | ** | + | ** Esi0063_0045 |
− | ** | + | ** CHS |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GPPSYN-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
− | * [[ | + | == Pathways associated == |
− | + | * [[PWY-7736]] | |
− | * [[ | + | * [[PWY-6859]] |
− | * [[ | + | * [[PWY-7709]] |
− | + | * [[PWY-6383]] | |
+ | * [[PWY-7182]] | ||
+ | * [[PWY-7141]] | ||
+ | * [[PWY-5123]] | ||
+ | * [[PWY-5122]] | ||
+ | * [[PWY-7102]] | ||
+ | * [[PWY-7659]] | ||
+ | * [[PWY-7410]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6057204}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=6062313}} | |
− | + | {{#set: centisome position=92.3294 }} | |
− | + | {{#set: common name=Esi_0063_0045|Esi0063_0045|CHS}} | |
− | + | {{#set: reaction associated=GPPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7736|PWY-6859|PWY-7709|PWY-6383|PWY-7182|PWY-7141|PWY-5123|PWY-5122|PWY-7102|PWY-7659|PWY-7410}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:59, 21 March 2018
Gene Ec-14_006550
- left end position:
- 6057204
- transcription direction:
- POSITIVE
- right end position:
- 6062313
- centisome position:
- 92.3294
- Synonym(s):
- Esi_0063_0045
- Esi0063_0045
- CHS
Reactions associated
- Reaction: GPPSYN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome