Difference between revisions of "Ec-19 002580"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-458 CPD-458] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-19_002580 == * left end position: ** 2875570 * transcription direction: ** NEGATIVE * right end position: ** 2878296 * centisome position: ** 48.1...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-19_002580 == |
− | * | + | * left end position: |
− | ** | + | ** 2875570 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2878296 |
− | * | + | * centisome position: |
− | ** | + | ** 48.16145 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0035_0093 |
− | ** | + | ** Esi0035_0093 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[GLYOXIII-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: automated-name-match |
− | + | == Pathways associated == | |
== External links == | == External links == | ||
− | + | {{#set: left end position=2875570}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2878296}} | |
− | + | {{#set: centisome position=48.16145 }} | |
− | + | {{#set: common name=Esi_0035_0093|Esi0035_0093}} | |
− | + | {{#set: reaction associated=GLYOXIII-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:59, 21 March 2018
Gene Ec-19_002580
- left end position:
- 2875570
- transcription direction:
- NEGATIVE
- right end position:
- 2878296
- centisome position:
- 48.16145
- Synonym(s):
- Esi_0035_0093
- Esi0035_0093
Reactions associated
- Reaction: GLYOXIII-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome