Difference between revisions of "Ec-18 002590"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER] == * smiles:...")
 
(Created page with "Category:Gene == Gene Ec-18_002590 == * left end position: ** 2567910 * transcription direction: ** NEGATIVE * right end position: ** 2573457 * centisome position: ** 52.1...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER] ==
+
== Gene Ec-18_002590 ==
* smiles:
+
* left end position:
** CC(=O)NC3(C(CC(C(=O)[O-])(OC1(C(O)C(OC(CO)C(O)1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)
+
** 2567910
* common name:
+
* transcription direction:
** α-N-acetylneuraminyl-(2→3)-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R
+
** NEGATIVE
 +
* right end position:
 +
** 2573457
 +
* centisome position:
 +
** 52.123825   
 
* Synonym(s):
 
* Synonym(s):
** α-N-acetylneuraminyl-2,3-β-D-galactosyl-1,4-N-acetyl-D-glucosaminyl-glycoprotein
+
** Esi_0053_0138
 +
** Esi0053_0138
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN0-1281]]
* [[2.4.99.6-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: left end position=2567910}}
** [http://www.genome.jp/dbget-bin/www_bget?C04907 C04907]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=CC(=O)NC3(C(CC(C(=O)[O-])(OC1(C(O)C(OC(CO)C(O)1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)}}
+
{{#set: right end position=2573457}}
{{#set: common name=α-N-acetylneuraminyl-(2→3)-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R}}
+
{{#set: centisome position=52.123825    }}
{{#set: common name=α-N-acetylneuraminyl-2,3-β-D-galactosyl-1,4-N-acetyl-D-glucosaminyl-glycoprotein}}
+
{{#set: common name=Esi_0053_0138|Esi0053_0138}}
{{#set: produced by=2.4.99.6-RXN}}
+
{{#set: reaction associated=RXN0-1281}}

Latest revision as of 19:59, 21 March 2018

Gene Ec-18_002590

  • left end position:
    • 2567910
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2573457
  • centisome position:
    • 52.123825
  • Synonym(s):
    • Esi_0053_0138
    • Esi0053_0138

Reactions associated

Pathways associated

External links