Difference between revisions of "Ec-02 005010"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] == * smiles: ** CC(C...")
 
(Created page with "Category:Gene == Gene Ec-02_005010 == * left end position: ** 5296490 * transcription direction: ** POSITIVE * right end position: ** 5301942 * centisome position: ** 81.1...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] ==
+
== Gene Ec-02_005010 ==
* smiles:
+
* left end position:
** CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-]
+
** 5296490
* inchi key:
+
* transcription direction:
** InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M
+
** POSITIVE
* common name:
+
* right end position:
** N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
+
** 5301942
* molecular weight:
+
* centisome position:
** 362.42    
+
** 81.13756    
 
* Synonym(s):
 
* Synonym(s):
** ACV
+
** Esi_0024_0107
** L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine
+
** Esi0024_0107
** δ(L-2-aminoadipyl)-L-cysteinyl-D-valine
+
** PSB
** N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
+
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[1.21.3.1-RXN]]
+
* Reaction: [[PSII-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-101]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=5296490}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820470 91820470]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: right end position=5301942}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58572 58572]
+
{{#set: centisome position=81.13756   }}
* LIGAND-CPD:
+
{{#set: common name=Esi_0024_0107|Esi0024_0107|PSB}}
** [http://www.genome.jp/dbget-bin/www_bget?C05556 C05556]
+
{{#set: reaction associated=PSII-RXN}}
{{#set: smiles=CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-]}}
+
{{#set: pathway associated=PWY-101}}
{{#set: inchi key=InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M}}
+
{{#set: common name=N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine}}
+
{{#set: molecular weight=362.42   }}
+
{{#set: common name=ACV|L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine|δ(L-2-aminoadipyl)-L-cysteinyl-D-valine|N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine}}
+
{{#set: consumed by=1.21.3.1-RXN}}
+

Latest revision as of 20:59, 21 March 2018

Gene Ec-02_005010

  • left end position:
    • 5296490
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5301942
  • centisome position:
    • 81.13756
  • Synonym(s):
    • Esi_0024_0107
    • Esi0024_0107
    • PSB

Reactions associated

Pathways associated

External links