Difference between revisions of "Ec-19 001450"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == * smiles: ** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1) * inchi key...") |
(Created page with "Category:Gene == Gene Ec-19_001450 == * left end position: ** 1604435 * transcription direction: ** POSITIVE * right end position: ** 1618055 * centisome position: ** 26.8...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-19_001450 == |
− | * | + | * left end position: |
− | ** | + | ** 1604435 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1618055 |
− | * | + | * centisome position: |
− | ** | + | ** 26.87186 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0121_0044 |
− | ** | + | ** Esi0121_0044 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-aragem]] |
− | == | + | * Reaction: [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] |
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[PEROXID-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-14240]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-15288]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-17352]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-8635]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6797]] | ||
+ | * [[PWY-7214]] | ||
+ | * [[PWY-7539]] | ||
+ | * [[PWY-5461]] | ||
+ | * [[PWY-7445]] | ||
+ | * [[PWY-6824]] | ||
+ | * [[PWY-5469]] | ||
+ | * [[PWY-5466]] | ||
+ | * [[PWY-6147]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1604435}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1618055}} | |
− | + | {{#set: centisome position=26.87186 }} | |
− | + | {{#set: common name=Esi_0121_0044|Esi0121_0044}} | |
− | + | {{#set: reaction associated=DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN|H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN|PEROXID-RXN|RXN-14240|RXN-15288|RXN-17352|RXN-8635}} | |
− | {{#set: | + | {{#set: pathway associated=PWY-6797|PWY-7214|PWY-7539|PWY-5461|PWY-7445|PWY-6824|PWY-5469|PWY-5466|PWY-6147}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:59, 21 March 2018
Gene Ec-19_001450
- left end position:
- 1604435
- transcription direction:
- POSITIVE
- right end position:
- 1618055
- centisome position:
- 26.87186
- Synonym(s):
- Esi_0121_0044
- Esi0121_0044
Reactions associated
- Reaction: DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN
- Source: orthology-aragem
- Reaction: H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN
- Source: orthology-aragem
- Reaction: PEROXID-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14240
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15288
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17352
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-8635
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome