Difference between revisions of "D-MYO-INOSITOL-34-BISPHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OCC2(C(O)C(C([N+]1(C=CC=C(C(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-34-BISPHOSPHATE D-MYO-INOSITOL-34-BISPHOSPHATE] == * smiles: ** C1(O)(C(O)C(O)C(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-34-BISPHOSPHATE D-MYO-INOSITOL-34-BISPHOSPHATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=MCKAJXMRULSUKI-CNWJWELYSA-J |
* common name: | * common name: | ||
− | ** | + | ** D-myo-inositol (3,4)-bisphosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 336.085 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 1D-myo-inositol (3,4)-bisphosphate |
− | ** | + | ** inositol (3,4)-bisphosphate |
− | ** | + | ** (2,3,4,5)-tetrahydroxy-6-phosphonooxy-cyclohexoxy)phosphonic acid |
− | ** | + | ** Ins(3,4)P2 |
− | + | ** I(3,4)P2 | |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10939]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21120281 21120281] |
− | * | + | * CHEMSPIDER: |
− | + | ** [http://www.chemspider.com/Chemical-Structure.19980559.html 19980559] | |
− | ** [http://www. | + | |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83241 83241] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04063 C04063] |
− | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB06235 |
− | {{#set: common name= | + | {{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1)}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=MCKAJXMRULSUKI-CNWJWELYSA-J}} |
− | {{#set: common name= | + | {{#set: common name=D-myo-inositol (3,4)-bisphosphate}} |
− | + | {{#set: molecular weight=336.085 }} | |
− | {{#set: produced by= | + | {{#set: common name=1D-myo-inositol (3,4)-bisphosphate|inositol (3,4)-bisphosphate|(2,3,4,5)-tetrahydroxy-6-phosphonooxy-cyclohexoxy)phosphonic acid|Ins(3,4)P2|I(3,4)P2}} |
+ | {{#set: produced by=RXN-10939}} |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE
- smiles:
- C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1)
- inchi key:
- InChIKey=MCKAJXMRULSUKI-CNWJWELYSA-J
- common name:
- D-myo-inositol (3,4)-bisphosphate
- molecular weight:
- 336.085
- Synonym(s):
- 1D-myo-inositol (3,4)-bisphosphate
- inositol (3,4)-bisphosphate
- (2,3,4,5)-tetrahydroxy-6-phosphonooxy-cyclohexoxy)phosphonic acid
- Ins(3,4)P2
- I(3,4)P2
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1)" cannot be used as a page name in this wiki.