Difference between revisions of "DEAMIDO-NAD"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiocarboxylated-MPT-synthases Thiocarboxylated-MPT-synthases] == * common name: ** a thiocarbo...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OCC2(C(O)C(C([N+]1(C=CC=C(C(...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == |
| + | * smiles: | ||
| + | ** C(OP(=O)([O-])OP(=O)([O-])OCC2(C(O)C(C([N+]1(C=CC=C(C([O-])=O)C=1))O2)O))C3(C(O)C(O)C(O3)N5(C=NC4(C(N)=NC=NC=45))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** nicotinate adenine dinucleotide |
| + | * molecular weight: | ||
| + | ** 662.399 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** Deamino-NAD+ | ||
| + | ** NaADN | ||
| + | ** deamido-NAD+ | ||
| + | ** deamidonicotinamide adenine dinucleoetide | ||
| + | ** deamido-NAD | ||
| + | ** NAAD | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[NAD-SYNTH-NH3-RXN]] |
| + | * [[NAD-SYNTH-GLN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[NICONUCADENYLYLTRAN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 6450-77-7 |
| − | {{#set: consumed by=RXN- | + | * DRUGBANK : DB04099 |
| − | {{#set: produced by= | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266646 45266646] | ||
| + | * HMDB : HMDB01179 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00857 C00857] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58437 58437] | ||
| + | * BIGG : 36219 | ||
| + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OCC2(C(O)C(C([N+]1(C=CC=C(C([O-])=O)C=1))O2)O))C3(C(O)C(O)C(O3)N5(C=NC4(C(N)=NC=NC=45)))}} | ||
| + | {{#set: inchi key=InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L}} | ||
| + | {{#set: common name=nicotinate adenine dinucleotide}} | ||
| + | {{#set: molecular weight=662.399 }} | ||
| + | {{#set: common name=Deamino-NAD+|NaADN|deamido-NAD+|deamidonicotinamide adenine dinucleoetide|deamido-NAD|NAAD}} | ||
| + | {{#set: consumed by=NAD-SYNTH-NH3-RXN|NAD-SYNTH-GLN-RXN}} | ||
| + | {{#set: produced by=NICONUCADENYLYLTRAN-RXN}} | ||
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite DEAMIDO-NAD
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OCC2(C(O)C(C([N+]1(C=CC=C(C([O-])=O)C=1))O2)O))C3(C(O)C(O)C(O3)N5(C=NC4(C(N)=NC=NC=45)))
- inchi key:
- InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L
- common name:
- nicotinate adenine dinucleotide
- molecular weight:
- 662.399
- Synonym(s):
- Deamino-NAD+
- NaADN
- deamido-NAD+
- deamidonicotinamide adenine dinucleoetide
- deamido-NAD
- NAAD
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 6450-77-7
- DRUGBANK : DB04099
- PUBCHEM:
- HMDB : HMDB01179
- LIGAND-CPD:
- CHEBI:
- BIGG : 36219
"C(OP(=O)([O-])OP(=O)([O-])OCC2(C(O)C(C([N+]1(C=CC=C(C([O-])=O)C=1))O2)O))C3(C(O)C(O)C(O3)N5(C=NC4(C(N)=NC=NC=45)))" cannot be used as a page name in this wiki.
