Difference between revisions of "11Z-3-oxo-icos-11-enoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITP DITP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=11Z-3-oxo-icos-11-enoyl-ACPs 11Z-3-oxo-icos-11-enoyl-ACPs] == * common name: ** an (11Z)-3-oxo-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITP DITP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=11Z-3-oxo-icos-11-enoyl-ACPs 11Z-3-oxo-icos-11-enoyl-ACPs] ==
−
* smiles:
+
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
+
−
* inchi key:
+
−
** InChIKey=UFJPAQSLHAGEBL-RRKCRQDMSA-J
+
 
* common name:
 
* common name:
−
** dITP
+
** an (11Z)-3-oxo-icos-11-enoyl-[acp]
−
* molecular weight:
+
−
** 488.137   
+
 
* Synonym(s):
 
* Synonym(s):
−
** deoxyinosine triphosphate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN0-1602]]
+
* [[RXN-16630]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16629]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-14228]]
 
 
== External links  ==
 
== External links  ==
−
* BIGG : 37399
+
{{#set: common name=an (11Z)-3-oxo-icos-11-enoyl-[acp]}}
−
* PUBCHEM:
+
{{#set: consumed by=RXN-16630}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203822 25203822]
+
{{#set: produced by=RXN-16629}}
−
* HMDB : HMDB03537
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01345 C01345]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61382 61382]
+
−
* METABOLIGHTS : MTBLC61382
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=UFJPAQSLHAGEBL-RRKCRQDMSA-J}}
+
−
{{#set: common name=dITP}}
+
−
{{#set: molecular weight=488.137    }}
+
−
{{#set: common name=deoxyinosine triphosphate}}
+
−
{{#set: consumed by=RXN0-1602}}
+
−
{{#set: consumed or produced by=RXN-14228}}
+

Latest revision as of 20:00, 21 March 2018

Metabolite 11Z-3-oxo-icos-11-enoyl-ACPs

  • common name:
    • an (11Z)-3-oxo-icos-11-enoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an (11Z)-3-oxo-icos-11-enoyl-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=11Z-3-oxo-icos-11-enoyl-ACPs&oldid=30888"