Difference between revisions of "4-HYDROXY-L-PROLINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CH3-MALONATE-S-ALD CH3-MALONATE-S-ALD] == * smiles: ** CC([CH]=O)C(=O)[O-] * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXY-L-PROLINE 4-HYDROXY-L-PROLINE] == * smiles: ** C1([N+]C(C(=O)[O-])CC(O)1) * inchi key...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXY-L-PROLINE 4-HYDROXY-L-PROLINE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1([N+]C(C(=O)[O-])CC(O)1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PMMYEEVYMWASQN-DMTCNVIQSA-N |
* common name: | * common name: | ||
− | ** | + | ** trans-4-hydroxy-L-proline |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 131.131 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** trans-4-hydroxyproline |
− | ** ( | + | ** trans-oxyproline |
+ | ** trans-L-4-hydroxyproline | ||
+ | ** trans-hydroxy-L-proline | ||
+ | ** trans-L-4-hydroxy-proline | ||
+ | ** (2S,4R)-4-hydroxypyrrolidinium-2-carboxylate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN66-546]] |
+ | * [[RXN490-3641]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | * CAS : | + | * NCI: |
+ | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=46704 46704] | ||
+ | * CAS : 51-35-4 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971053 6971053] |
− | * HMDB : | + | * HMDB : HMDB00725 |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58375 58375] |
− | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC58375 |
− | {{#set: smiles= | + | {{#set: smiles=C1([N+]C(C(=O)[O-])CC(O)1)}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=PMMYEEVYMWASQN-DMTCNVIQSA-N}} |
− | {{#set: common name= | + | {{#set: common name=trans-4-hydroxy-L-proline}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=131.131 }} |
− | {{#set: common name= | + | {{#set: common name=trans-4-hydroxyproline|trans-oxyproline|trans-L-4-hydroxyproline|trans-hydroxy-L-proline|trans-L-4-hydroxy-proline|(2S,4R)-4-hydroxypyrrolidinium-2-carboxylate}} |
− | + | {{#set: produced by=RXN66-546|RXN490-3641}} | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite 4-HYDROXY-L-PROLINE
- smiles:
- C1([N+]C(C(=O)[O-])CC(O)1)
- inchi key:
- InChIKey=PMMYEEVYMWASQN-DMTCNVIQSA-N
- common name:
- trans-4-hydroxy-L-proline
- molecular weight:
- 131.131
- Synonym(s):
- trans-4-hydroxyproline
- trans-oxyproline
- trans-L-4-hydroxyproline
- trans-hydroxy-L-proline
- trans-L-4-hydroxy-proline
- (2S,4R)-4-hydroxypyrrolidinium-2-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1([N+]C(C(=O)[O-])CC(O)1)" cannot be used as a page name in this wiki.